Difference between revisions of "CPD-513"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00006269001_1 == * Synonym(s): == Reactions associated == * KYNURENINE-3-MONOOXYGENASE-RXN ** pantograph-galdieria.sulphuraria == P...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-513 CPD-513] == |
+ | * smiles: | ||
+ | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-] | ||
+ | * molecular weight: | ||
+ | ** 911.663 | ||
+ | * inchi key: | ||
+ | ** InChIKey=AAZZVFONLHYNDZ-NVQRUNIKSA-J | ||
+ | * common name: | ||
+ | ** 3-hydroxy-3-phenylpropanoyl-CoA | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** hydroxycinnamoyl-CoA (ambiguous) | ||
+ | ** β-hydroxyphenyl-propionyl-CoA | ||
+ | ** 3-hydroxy-3-phenylpropionyl-coenzyme A | ||
+ | ** 3-hydroxy-3-phenylpropionyl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-11278]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[RXN-2002]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71294 71294] |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70680322 70680322] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C06362 C06362] | ||
+ | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}} | ||
+ | {{#set: molecular weight=911.663 }} | ||
+ | {{#set: inchi key=InChIKey=AAZZVFONLHYNDZ-NVQRUNIKSA-J}} | ||
+ | {{#set: common name=3-hydroxy-3-phenylpropanoyl-CoA}} | ||
+ | {{#set: common name=hydroxycinnamoyl-CoA (ambiguous)|β-hydroxyphenyl-propionyl-CoA|3-hydroxy-3-phenylpropionyl-coenzyme A|3-hydroxy-3-phenylpropionyl-CoA}} | ||
+ | {{#set: consumed by=RXN-11278}} | ||
+ | {{#set: produced by=RXN-2002}} |
Latest revision as of 16:55, 9 January 2019
Contents
Metabolite CPD-513
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
- molecular weight:
- 911.663
- inchi key:
- InChIKey=AAZZVFONLHYNDZ-NVQRUNIKSA-J
- common name:
- 3-hydroxy-3-phenylpropanoyl-CoA
- Synonym(s):
- hydroxycinnamoyl-CoA (ambiguous)
- β-hydroxyphenyl-propionyl-CoA
- 3-hydroxy-3-phenylpropionyl-coenzyme A
- 3-hydroxy-3-phenylpropionyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.