Difference between revisions of "DI-H-OROTATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ THZ] == * smiles: ** CC1(N=CSC(CCO)=1) * inchi key: ** InChIKey=BKAWJIRCKVUVED-UHFFFAOYSA-N...") |
|||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DI-H-OROTATE DI-H-OROTATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C1(C(=O)NC(=O)NC(C(=O)[O-])1) |
| + | * molecular weight: | ||
| + | ** 157.105 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=UFIVEPVSAGBUSI-REOHCLBHSA-M |
* common name: | * common name: | ||
| − | ** | + | ** (S)-dihydroorotate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** 4- | + | ** dihydro-L-orotate |
| − | ** | + | ** (S)-4,5-dihydroorotate |
| − | ** 4- | + | ** (S)-4,5-dihydroorotic acid |
| − | ** | + | ** (S)-hydroorotic acid |
| + | ** (S)-di-H-orotate | ||
| + | ** L-dihydroorotate | ||
| + | ** 4,5-dihydro-L-orotate | ||
| + | ** L-4,5-dihydroorotate | ||
| + | ** (S)-4-pyrimidinecarboxylic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[DIHYDROOROT-RXN]] | ||
== External links == | == External links == | ||
| − | + | * METABOLIGHTS : MTBLC30864 | |
| − | * METABOLIGHTS : | + | * BIGG : dhor__S |
| − | * | + | * CAS : 5988-19-2 |
| − | * | + | * CAS : 155-54-4 |
| − | * | + | * HMDB : HMDB00528 |
| − | * HMDB : | + | |
| − | + | ||
| − | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.4573876.html 4573876] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30864 30864] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00337 C00337] |
| − | {{#set: inchi key=InChIKey= | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460289 5460289] |
| − | + | {{#set: smiles=C1(C(=O)NC(=O)NC(C(=O)[O-])1)}} | |
| − | {{#set: common name=4- | + | {{#set: molecular weight=157.105 }} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=UFIVEPVSAGBUSI-REOHCLBHSA-M}} |
| + | {{#set: common name=(S)-dihydroorotate}} | ||
| + | {{#set: common name=dihydro-L-orotate|(S)-4,5-dihydroorotate|(S)-4,5-dihydroorotic acid|(S)-hydroorotic acid|(S)-di-H-orotate|L-dihydroorotate|4,5-dihydro-L-orotate|L-4,5-dihydroorotate|(S)-4-pyrimidinecarboxylic acid}} | ||
| + | {{#set: reversible reaction associated=DIHYDROOROT-RXN}} | ||
Latest revision as of 16:55, 9 January 2019
Contents
Metabolite DI-H-OROTATE
- smiles:
- C1(C(=O)NC(=O)NC(C(=O)[O-])1)
- molecular weight:
- 157.105
- inchi key:
- InChIKey=UFIVEPVSAGBUSI-REOHCLBHSA-M
- common name:
- (S)-dihydroorotate
- Synonym(s):
- dihydro-L-orotate
- (S)-4,5-dihydroorotate
- (S)-4,5-dihydroorotic acid
- (S)-hydroorotic acid
- (S)-di-H-orotate
- L-dihydroorotate
- 4,5-dihydro-L-orotate
- L-4,5-dihydroorotate
- (S)-4-pyrimidinecarboxylic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- METABOLIGHTS : MTBLC30864
- BIGG : dhor__S
- CAS : 5988-19-2
- CAS : 155-54-4
- HMDB : HMDB00528
- CHEMSPIDER:
- CHEBI:
- LIGAND-CPD:
- PUBCHEM:
"C1(C(=O)NC(=O)NC(C(=O)[O-])1)" cannot be used as a page name in this wiki.
