Difference between revisions of "CHC T00008907001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-602 CPD-602] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)NC2(=C(N)C(=O)NC(=O)N2)) *...") |
(Created page with "Category:Gene == Gene CHC_T00008907001_1 == * Synonym(s): == Reactions associated == * Reaction: 2.7.7.14-RXN ** Source: orthology-ectocarpus_siliculosus ** Sourc...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008907001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[2.7.7.14-RXN]] |
− | + | ** Source: [[orthology-ectocarpus_siliculosus]] | |
− | * [[ | + | ** Source: [[orthology-arabidopsis_thaliana]] |
− | == | + | == Pathways associated == |
+ | * [[PWY-7782]] | ||
+ | * [[PWY4FS-6]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=2.7.7.14-RXN}} | |
− | + | {{#set: pathway associated=PWY-7782|PWY4FS-6}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 16:09, 23 May 2018
Gene CHC_T00008907001_1
- Synonym(s):
Reactions associated
- Reaction: 2.7.7.14-RXN
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana