Difference between revisions of "PWY0-1587"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4617 CPD-4617] == * smiles: ** CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O) * in...") |
|||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1587 PWY0-1587] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** N6-L-threonylcarbamoyladenosine37-modified tRNA biosynthesis |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | ||
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''2''' reactions in the full pathway | |
| − | * [[ | + | * [[RXN-14570]] |
| − | == Reaction(s) | + | ** 1 associated gene(s): |
| + | *** [[CHC_T00000321001_1]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14569 RXN-14569] | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1587 PWY0-1587] |
| − | + | {{#set: common name=N6-L-threonylcarbamoyladenosine37-modified tRNA biosynthesis}} | |
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | {{#set: | + | {{#set: taxonomic range=TAX-2157}} |
| − | {{#set: | + | {{#set: reaction found=1}} |
| − | {{#set: | + | {{#set: total reaction=2}} |
| − | {{#set: | + | {{#set: completion rate=50.0}} |
| − | {{#set: | + | |
Latest revision as of 16:47, 9 January 2019
Pathway PWY0-1587
- common name:
- N6-L-threonylcarbamoyladenosine37-modified tRNA biosynthesis
- taxonomic range:
- Synonym(s):
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- RXN-14570
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
