Difference between revisions of "PWY-5268"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8610 CPD-8610] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C...")
 
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8610 CPD-8610] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5268 PWY-5268] ==
* smiles:
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
+
* inchi key:
+
** InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N
+
 
* common name:
 
* common name:
** 4,4-dimethyl-5α-cholesta-8-en-3-β-ol
+
** salvianin biosynthesis
* molecular weight:
+
* taxonomic range:
** 414.713   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-3398]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-13711]]
+
'''1''' reactions found over '''6''' reactions in the full pathway
* [[RXN66-15]]
+
* [[RXN-7828]]
== Reaction(s) known to produce the compound ==
+
** 3 associated gene(s):
* [[RXN66-14]]
+
*** [[CHC_T00000989001_1]]
== Reaction(s) of unknown directionality ==
+
*** [[CHC_T00001656001_1]]
 +
*** [[CHC_T00003244001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-arabidopsis_thaliana]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.172-RXN 2.3.1.172-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7997 RXN-7997]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8138 RXN-8138]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8139 RXN-8139]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8140 RXN-8140]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=salvianin biosynthesis}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12070223 12070223]
+
{{#set: taxonomic range=TAX-3398}}
* CHEMSPIDER:
+
{{#set: reaction found=1}}
** [http://www.chemspider.com/Chemical-Structure.10474091.html 10474091]
+
{{#set: total reaction=6}}
* LIGAND-CPD:
+
{{#set: completion rate=17.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C15915 C15915]
+
* HMDB : HMDB06840
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
+
{{#set: inchi key=InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N}}
+
{{#set: common name=4,4-dimethyl-5α-cholesta-8-en-3-β-ol}}
+
{{#set: molecular weight=414.713    }}
+
{{#set: consumed by=RXN-13711|RXN66-15}}
+
{{#set: produced by=RXN66-14}}
+

Latest revision as of 17:48, 9 January 2019

Pathway PWY-5268

  • common name:
    • salvianin biosynthesis
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

1 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links