Difference between revisions of "CPD-4617"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-Stearoyl-L-Phosphatidate 1-Stearoyl-L-Phosphatidate] == * common name: ** a 1-stearoyl 2-acyl...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-Stearoyl-L-Phosphatidate 1-Stearoyl-L-Phosphatidate] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4617 CPD-4617] ==
 +
* smiles:
 +
** CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O)
 +
* molecular weight:
 +
** 383.403   
 +
* inchi key:
 +
** InChIKey=QRZHDHJUYBONQQ-JSYMRTRDSA-N
 
* common name:
 
* common name:
** a 1-stearoyl 2-acyl-sn-glycerol 3-phosphate
+
** dihydrozeatin-O-glucoside
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16067]]
+
* [[RXN-4726]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a 1-stearoyl 2-acyl-sn-glycerol 3-phosphate}}
+
* PUBCHEM:
{{#set: produced by=RXN-16067}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658286 90658286]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C16448 C16448]
 +
* HMDB : HMDB12214
 +
{{#set: smiles=CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O)}}
 +
{{#set: molecular weight=383.403    }}
 +
{{#set: inchi key=InChIKey=QRZHDHJUYBONQQ-JSYMRTRDSA-N}}
 +
{{#set: common name=dihydrozeatin-O-glucoside}}
 +
{{#set: produced by=RXN-4726}}

Latest revision as of 16:58, 9 January 2019

Metabolite CPD-4617

  • smiles:
    • CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O)
  • molecular weight:
    • 383.403
  • inchi key:
    • InChIKey=QRZHDHJUYBONQQ-JSYMRTRDSA-N
  • common name:
    • dihydrozeatin-O-glucoside
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links