Difference between revisions of "CPD-11876"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cytochromes-C-Reduced Cytochromes-C-Reduced] == * common name: ** a reduced c-type cytochrome *...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11876 CPD-11876] == |
| + | * smiles: | ||
| + | ** COC1(=C(O)C=CC(C(O)C=O)=C1) | ||
| + | * molecular weight: | ||
| + | ** 182.176 | ||
| + | * inchi key: | ||
| + | ** InChIKey=VISAJVAPYPFKCL-QMMMGPOBSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-methoxy-4-hydroxyphenylglycolaldehyde |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** MOPEGAL |
| − | ** | + | ** 4-hydroxy-3-methoxymandelaldehyde |
| − | ** | + | ** 3-methoxy 4-hydroxy mandelic aldehyde |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-10917]] |
| − | + | ||
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[RXN-10915]] |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658114 90658114] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05583 C05583] |
| − | {{#set: | + | * CHEMSPIDER: |
| + | ** [http://www.chemspider.com/Chemical-Structure.389601.html 389601] | ||
| + | * HMDB : HMDB04061 | ||
| + | {{#set: smiles=COC1(=C(O)C=CC(C(O)C=O)=C1)}} | ||
| + | {{#set: molecular weight=182.176 }} | ||
| + | {{#set: inchi key=InChIKey=VISAJVAPYPFKCL-QMMMGPOBSA-N}} | ||
| + | {{#set: common name=3-methoxy-4-hydroxyphenylglycolaldehyde}} | ||
| + | {{#set: common name=MOPEGAL|4-hydroxy-3-methoxymandelaldehyde|3-methoxy 4-hydroxy mandelic aldehyde}} | ||
| + | {{#set: consumed by=RXN-10917}} | ||
| + | {{#set: reversible reaction associated=RXN-10915}} | ||
Latest revision as of 15:07, 9 January 2019
Contents
Metabolite CPD-11876
- smiles:
- COC1(=C(O)C=CC(C(O)C=O)=C1)
- molecular weight:
- 182.176
- inchi key:
- InChIKey=VISAJVAPYPFKCL-QMMMGPOBSA-N
- common name:
- 3-methoxy-4-hydroxyphenylglycolaldehyde
- Synonym(s):
- MOPEGAL
- 4-hydroxy-3-methoxymandelaldehyde
- 3-methoxy 4-hydroxy mandelic aldehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
