Difference between revisions of "CHC T00008316001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCMP DCMP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP([O-])([O-])=O * inchi key: **...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008316001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[INORGPYROPHOSPHAT-RXN]] |
− | * [[RXN- | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
− | * [[ | + | * Reaction: [[RXN-12720]] |
− | + | ** Source: [[orthology-galdieria.sulphuraria]] | |
− | * [[ | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
− | * [[ | + | ** Source: [[orthology-arabidopsis_thaliana]] |
− | * [[ | + | * Reaction: [[SULFATE-ADENYLYLTRANS-RXN]] |
− | == | + | ** Source: [[orthology-galdieria.sulphuraria]] |
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7807]] | ||
+ | * [[PWY-6932]] | ||
+ | * [[DISSULFRED-PWY]] | ||
+ | * [[PWY-5278]] | ||
+ | * [[PWY-7805]] | ||
+ | * [[PWY-5340]] | ||
+ | * [[PWY-6683]] | ||
+ | * [[SULFMETII-PWY]] | ||
+ | * [[P224-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=INORGPYROPHOSPHAT-RXN|RXN-12720|SULFATE-ADENYLYLTRANS-RXN}} | |
− | + | {{#set: pathway associated=PWY-7807|PWY-6932|DISSULFRED-PWY|PWY-5278|PWY-7805|PWY-5340|PWY-6683|SULFMETII-PWY|P224-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 16:48, 9 January 2019
Gene CHC_T00008316001_1
- Synonym(s):
Reactions associated
- Reaction: INORGPYROPHOSPHAT-RXN
- Source: orthology-ectocarpus_siliculosus
- Reaction: RXN-12720
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana
- Reaction: SULFATE-ADENYLYLTRANS-RXN
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana