Difference between revisions of "CIS-DELTA3-ENOYL-COA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11878 CPD-11878] == * smiles: ** C(O)C(O)C1(C=CC(O)=C(O)C=1) * inchi key: ** InChIKey=MTVWF...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIS-DELTA3-ENOYL-COA CIS-DELTA3-ENOYL-COA] == * common name: ** a cis-3-enoyl-CoA * Synonym(s):...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIS-DELTA3-ENOYL-COA CIS-DELTA3-ENOYL-COA] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** 3 | + | ** a cis-3-enoyl-CoA |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** cis-Δ3-enoyl-CoA |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[ENOYL-COA-DELTA-ISOM-RXN]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a cis-3-enoyl-CoA}} | |
− | + | {{#set: common name=cis-Δ3-enoyl-CoA}} | |
− | + | {{#set: reversible reaction associated=ENOYL-COA-DELTA-ISOM-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name=3 | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 16:11, 23 May 2018
Contents
Metabolite CIS-DELTA3-ENOYL-COA
- common name:
- a cis-3-enoyl-CoA
- Synonym(s):
- cis-Δ3-enoyl-CoA