Difference between revisions of "CPD-18346"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE-5P PYRIDOXAMINE-5P] == * smiles: ** CC1(C(=C(C(COP([O-])([O-])=O)=CN=1)C[N+])O) *...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18346 CPD-18346] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCCC=CCCCCCCCCCC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O |
| + | * molecular weight: | ||
| + | ** 1027.953 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=HEJOXXLSCAQQGQ-SAIINBSPSA-J |
* common name: | * common name: | ||
| − | ** | + | ** cis-vaccenoyl-CoA |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (Z)-octadec-11-enoyl CoA |
| − | ** | + | ** (Z)-11-octadecenoic acyl-CoA |
| + | ** cis-11-octadecenoic acyl-CoA | ||
| + | ** cis-octadec-11-enoic acyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17011]] |
| − | * [[RXN- | + | * [[RXN-17010]] |
| + | * [[RXN-17784]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-7238]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75121 75121] |
| − | * | + | * PUBCHEM: |
| − | {{#set: smiles= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71668355 71668355] |
| − | {{#set: | + | {{#set: smiles=CCCCCCC=CCCCCCCCCCC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O}} |
| − | {{#set: | + | {{#set: molecular weight=1027.953 }} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=HEJOXXLSCAQQGQ-SAIINBSPSA-J}} |
| − | {{#set: common name= | + | {{#set: common name=cis-vaccenoyl-CoA}} |
| − | {{#set: consumed by= | + | {{#set: common name=(Z)-octadec-11-enoyl CoA|(Z)-11-octadecenoic acyl-CoA|cis-11-octadecenoic acyl-CoA|cis-octadec-11-enoic acyl-CoA}} |
| − | {{#set: | + | {{#set: consumed by=RXN-17011|RXN-17010|RXN-17784}} |
| − | + | {{#set: produced by=RXN0-7238}} | |
Latest revision as of 16:59, 9 January 2019
Contents
Metabolite CPD-18346
- smiles:
- CCCCCCC=CCCCCCCCCCC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O
- molecular weight:
- 1027.953
- inchi key:
- InChIKey=HEJOXXLSCAQQGQ-SAIINBSPSA-J
- common name:
- cis-vaccenoyl-CoA
- Synonym(s):
- (Z)-octadec-11-enoyl CoA
- (Z)-11-octadecenoic acyl-CoA
- cis-11-octadecenoic acyl-CoA
- cis-octadec-11-enoic acyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CCCCCCCCCCC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O" cannot be used as a page name in this wiki.
