Difference between revisions of "PWY-5468"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-GLUTAMYL-P N-ACETYL-GLUTAMYL-P] == * smiles: ** CC(=O)NC(C([O-])=O)CCC(=O)OP([O-])(=O)...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-GLUTAMYL-P N-ACETYL-GLUTAMYL-P] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5468 PWY-5468] ==
* smiles:
+
** CC(=O)NC(C([O-])=O)CCC(=O)OP([O-])(=O)[O-]
+
* inchi key:
+
** InChIKey=FCVIHFVSXHOPSW-YFKPBYRVSA-K
+
 
* common name:
 
* common name:
** N-acetylglutamyl-phosphate
+
** lupanine biosynthesis
* molecular weight:
+
* taxonomic range:
** 266.124   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-3803]
 
* Synonym(s):
 
* Synonym(s):
** N-Acetyl-L-glutamyl 5-phosphate
 
** N-acetyl-L-glutamate-5-phosphate
 
** N-acetyl-glutamyl-P
 
** N-acetylglutamyl-P
 
** N-acetyl-5-glutamyl phosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[LYSDECARBOX-RXN]]
* [[N-ACETYLGLUTPREDUCT-RXN]]
+
** 1 associated gene(s):
* [[ACETYLGLUTKIN-RXN]]
+
*** [[CHC_T00000266001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8688 RXN-8688]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8692 RXN-8692]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8693 RXN-8693]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8694 RXN-8694]
 
== External links  ==
 
== External links  ==
* BIGG : acg5p
+
{{#set: common name=lupanine biosynthesis}}
* PUBCHEM:
+
{{#set: taxonomic range=TAX-3803}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791951 49791951]
+
{{#set: reaction found=1}}
* HMDB : HMDB06456
+
{{#set: total reaction=5}}
* LIGAND-CPD:
+
{{#set: completion rate=20.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C04133 C04133]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57936 57936]
+
* METABOLIGHTS : MTBLC57936
+
{{#set: smiles=CC(=O)NC(C([O-])=O)CCC(=O)OP([O-])(=O)[O-]}}
+
{{#set: inchi key=InChIKey=FCVIHFVSXHOPSW-YFKPBYRVSA-K}}
+
{{#set: common name=N-acetylglutamyl-phosphate}}
+
{{#set: molecular weight=266.124    }}
+
{{#set: common name=N-Acetyl-L-glutamyl 5-phosphate|N-acetyl-L-glutamate-5-phosphate|N-acetyl-glutamyl-P|N-acetylglutamyl-P|N-acetyl-5-glutamyl phosphate}}
+
{{#set: consumed or produced by=N-ACETYLGLUTPREDUCT-RXN|ACETYLGLUTKIN-RXN}}
+

Latest revision as of 17:52, 9 January 2019

Pathway PWY-5468

  • common name:
    • lupanine biosynthesis
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

1 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links