Difference between revisions of "L-methionyl-L-seryl-Protein"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROPHOSPHOGLYCEROL GLYCEROPHOSPHOGLYCEROL] == * smiles: ** C(C(COP(OCC(CO)O)([O-])=O)O)O *...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-methionyl-L-seryl-Protein L-methionyl-L-seryl-Protein] == * common name: ** an N-terminal-L-m...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROPHOSPHOGLYCEROL GLYCEROPHOSPHOGLYCEROL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-methionyl-L-seryl-Protein L-methionyl-L-seryl-Protein] ==
* smiles:
+
** C(C(COP(OCC(CO)O)([O-])=O)O)O
+
* inchi key:
+
** InChIKey=LLCSXHMJULHSJN-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** glycerophosphoglycerol
+
** an N-terminal-L-methionyl-L-seryl-[protein]
* molecular weight:
+
** 245.146   
+
 
* Synonym(s):
 
* Synonym(s):
** diglycerol phosphate
 
** bis(2,3-dihydroxypropyl) phosphate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14073]]
+
* [[RXN-17876]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an N-terminal-L-methionyl-L-seryl-[protein]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202983 25202983]
+
{{#set: consumed by=RXN-17876}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61933 61933]
+
* BIGG : g3pg
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C03274 C03274]
+
{{#set: smiles=C(C(COP(OCC(CO)O)([O-])=O)O)O}}
+
{{#set: inchi key=InChIKey=LLCSXHMJULHSJN-UHFFFAOYSA-M}}
+
{{#set: common name=glycerophosphoglycerol}}
+
{{#set: molecular weight=245.146    }}
+
{{#set: common name=diglycerol phosphate|bis(2,3-dihydroxypropyl) phosphate}}
+
{{#set: consumed by=RXN-14073}}
+

Latest revision as of 16:13, 23 May 2018

Metabolite L-methionyl-L-seryl-Protein

  • common name:
    • an N-terminal-L-methionyl-L-seryl-[protein]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an N-terminal-L-methionyl-L-seryl-[protein" cannot be used as a page name in this wiki.