Difference between revisions of "PWY-6118"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4211 CPD-4211] == * smiles: ** CC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-] * inchi key: ** InChIKe...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6118 PWY-6118] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** glycerol-3-phosphate shuttle |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** G3P shuttle |
| − | ** | + | ** glycerol-3-P shuttle |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''2''' reactions in the full pathway | |
| − | * [[ | + | * [[1.1.1.8-RXN]] |
| − | + | ** 2 associated gene(s): | |
| − | * [[ | + | *** [[CHC_T00009494001_1]] |
| − | * [[ | + | *** [[CHC_T00008461001_1]] |
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15745 RXN-15745] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=glycerol-3-phosphate shuttle}} | |
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: common name=G3P shuttle|glycerol-3-P shuttle}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=2}} | |
| − | + | {{#set: completion rate=50.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 16:52, 9 January 2019
Pathway PWY-6118
- common name:
- glycerol-3-phosphate shuttle
- taxonomic range:
- Synonym(s):
- G3P shuttle
- glycerol-3-P shuttle
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- 1.1.1.8-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
