Difference between revisions of "CHC T00008662001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12853 CPD-12853] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12853 CPD-12853] ==
+
== Gene CHC_T00008662001 ==
−
* smiles:
+
* left end position:
−
** CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
+
** 43667
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 4α-methyl-5α-cholesta-8,14,24-trien-3β-ol
+
** 45931
−
* molecular weight:
+
* centisome position:
−
** 396.655    
+
** 29.06251    
 
* Synonym(s):
 
* Synonym(s):
−
** cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[GLYCOGEN-BRANCH-RXN]]
−
* [[RXN-11881]]
+
** Source: [[annotation-original_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-14371]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-14372]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-7669]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-7710]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[GLYCOGENSYNTH-PWY]]
 +
* [[PWY-5067]]
 +
* [[PWY-622]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=43667}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102514956 102514956]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
+
{{#set: right end position=45931}}
−
{{#set: inchi key=InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N}}
+
{{#set: centisome position=29.06251   }}
−
{{#set: common name=4α-methyl-5α-cholesta-8,14,24-trien-3β-ol}}
+
{{#set: reaction associated=GLYCOGEN-BRANCH-RXN|RXN-14371|RXN-14372|RXN-7669|RXN-7710}}
−
{{#set: molecular weight=396.655   }}
+
{{#set: pathway associated=GLYCOGENSYNTH-PWY|PWY-5067|PWY-622}}
−
{{#set: common name=cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-}}
+
−
{{#set: produced by=RXN-11881}}
+

Latest revision as of 16:50, 9 January 2019

Gene CHC_T00008662001

  • left end position:
    • 43667
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 45931
  • centisome position:
    • 29.06251
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00008662001&oldid=22349"