Difference between revisions of "CPD-14394"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00006446001_1 == * Synonym(s): == Reactions associated == * GLUTCYSLIG-RXN ** pantograph-galdieria.sulphuraria == Pathways associat...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14394 CPD-14394] == |
| + | * smiles: | ||
| + | ** CCC=CCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
| + | * molecular weight: | ||
| + | ** 1049.959 | ||
| + | * inchi key: | ||
| + | ** InChIKey=PLHICYKOPITJJT-QWOXCLFSSA-J | ||
| + | * common name: | ||
| + | ** (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl-CoA | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** icosatetraenoyl-CoA | ||
| + | ** eicosatetraenoyl-CoA | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-16042]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74265 74265] |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581164 71581164] | ||
| + | {{#set: smiles=CCC=CCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
| + | {{#set: molecular weight=1049.959 }} | ||
| + | {{#set: inchi key=InChIKey=PLHICYKOPITJJT-QWOXCLFSSA-J}} | ||
| + | {{#set: common name=(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl-CoA}} | ||
| + | {{#set: common name=icosatetraenoyl-CoA|eicosatetraenoyl-CoA}} | ||
| + | {{#set: consumed by=RXN-16042}} | ||
Latest revision as of 17:01, 9 January 2019
Contents
Metabolite CPD-14394
- smiles:
- CCC=CCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- molecular weight:
- 1049.959
- inchi key:
- InChIKey=PLHICYKOPITJJT-QWOXCLFSSA-J
- common name:
- (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl-CoA
- Synonym(s):
- icosatetraenoyl-CoA
- eicosatetraenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
