Difference between revisions of "CHC T00008734001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] == * smiles: ** C=C1(C(CC([N+])C([O-])=O)C1) * inchi key: ** InChIKey=OOJZCX...") |
(Created page with "Category:Gene == Gene CHC_T00008734001_1 == * Synonym(s): == Reactions associated == * Reaction: 5.3.4.1-RXN ** Source: orthology-galdieria.sulphuraria * Reaction...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene CHC_T00008734001_1 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[RXN- | + | * Reaction: [[5.3.4.1-RXN]] |
| − | + | ** Source: [[orthology-galdieria.sulphuraria]] | |
| − | == | + | * Reaction: [[DISULISOM-RXN]] |
| + | ** Source: [[orthology-galdieria.sulphuraria]] | ||
| + | == Pathways associated == | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=5.3.4.1-RXN|DISULISOM-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Latest revision as of 16:14, 23 May 2018
Gene CHC_T00008734001_1
- Synonym(s):
Reactions associated
- Reaction: 5.3.4.1-RXN
- Source: orthology-galdieria.sulphuraria
- Reaction: DISULISOM-RXN
- Source: orthology-galdieria.sulphuraria
