Difference between revisions of "PWY3O-6"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOPORPHYRIN_IX PROTOPORPHYRIN_IX] == * smiles: ** C=CC1(C(C)=C2(C=C5(C(C)=C(CCC([O-])=O)C(C=...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOPORPHYRIN_IX PROTOPORPHYRIN_IX] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY3O-6 PWY3O-6] ==
* smiles:
+
** C=CC1(C(C)=C2(C=C5(C(C)=C(CCC([O-])=O)C(C=C4(C(CCC([O-])=O)=C(C)C(=CC3(C(C=C)=C(C)C(=CC=1N2)N=3))N4))=N5)))
+
* inchi key:
+
** InChIKey=KSFOVUSSGSKXFI-UJJXFSCMSA-L
+
 
* common name:
 
* common name:
** protoporphyrin IX
+
** dehydro-D-arabinono-1,4-lactone biosynthesis
* molecular weight:
+
* taxonomic range:
** 560.651   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 
* Synonym(s):
 
* Synonym(s):
 +
** previously called D-erythroascorbate (erythroascorbate, erythroascorbic acid) biosynthesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN1F-20]]
+
'''1''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[1.1.3.37-RXN]]
* [[PROTOPORGENOXI-RXN]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[CHC_T00000692001_1]]
* [[PROTOHEMEFERROCHELAT-RXN]]
+
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=1.1.1.117-RXN 1.1.1.117-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=D-ARABINOSE-1-DEHYDROGENASE-RXN D-ARABINOSE-1-DEHYDROGENASE-RXN]
 
== External links  ==
 
== External links  ==
* CAS : 553-12-8
+
{{#set: common name=dehydro-D-arabinono-1,4-lactone biosynthesis}}
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3794562 3794562]
+
{{#set: common name=previously called D-erythroascorbate (erythroascorbate, erythroascorbic acid) biosynthesis}}
* HMDB : HMDB00241
+
{{#set: reaction found=1}}
* LIGAND-CPD:
+
{{#set: total reaction=3}}
** [http://www.genome.jp/dbget-bin/www_bget?C02191 C02191]
+
{{#set: completion rate=33.0}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.20171337.html 20171337]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57306 57306]
+
* BIGG : ppp9
+
{{#set: smiles=C=CC1(C(C)=C2(C=C5(C(C)=C(CCC([O-])=O)C(C=C4(C(CCC([O-])=O)=C(C)C(=CC3(C(C=C)=C(C)C(=CC=1N2)N=3))N4))=N5)))}}
+
{{#set: inchi key=InChIKey=KSFOVUSSGSKXFI-UJJXFSCMSA-L}}
+
{{#set: common name=protoporphyrin IX}}
+
{{#set: molecular weight=560.651    }}
+
{{#set: consumed by=RXN1F-20}}
+
{{#set: produced by=PROTOPORGENOXI-RXN}}
+
{{#set: consumed or produced by=PROTOHEMEFERROCHELAT-RXN}}
+

Latest revision as of 14:56, 9 January 2019

Pathway PWY3O-6

  • common name:
    • dehydro-D-arabinono-1,4-lactone biosynthesis
  • taxonomic range:
  • Synonym(s):
    • previously called D-erythroascorbate (erythroascorbate, erythroascorbic acid) biosynthesis

Reaction(s) found

1 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links