Difference between revisions of "CPD-8612"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5939 PWY-5939] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8612 CPD-8612] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)([CH]=O)C(O)CC3)))CC4)))C |
| + | * molecular weight: | ||
| + | ** 428.697 | ||
| + | * inchi key: | ||
| + | ** InChIKey=WWTBBRMTEFBUND-WKYRUEGDSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** 4α-formyl-4β-methyl-5α-cholesta-8-en-3β-ol |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN66-17]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[RXN66-16]] |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87046 87046] |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263319 44263319] |
| − | {{#set: | + | * HMDB : HMDB12168 |
| + | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)([CH]=O)C(O)CC3)))CC4)))C}} | ||
| + | {{#set: molecular weight=428.697 }} | ||
| + | {{#set: inchi key=InChIKey=WWTBBRMTEFBUND-WKYRUEGDSA-N}} | ||
| + | {{#set: common name=4α-formyl-4β-methyl-5α-cholesta-8-en-3β-ol}} | ||
| + | {{#set: consumed by=RXN66-17}} | ||
| + | {{#set: produced by=RXN66-16}} | ||
Latest revision as of 14:58, 9 January 2019
Contents
Metabolite CPD-8612
- smiles:
- CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)([CH]=O)C(O)CC3)))CC4)))C
- molecular weight:
- 428.697
- inchi key:
- InChIKey=WWTBBRMTEFBUND-WKYRUEGDSA-N
- common name:
- 4α-formyl-4β-methyl-5α-cholesta-8-en-3β-ol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)([CH]=O)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.
