Difference between revisions of "RXN-9527"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8268 CPD-8268] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9527 RXN-9527] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-decanoyl-[acyl-carrier...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8268 CPD-8268] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9527 RXN-9527] ==
−
* smiles:
+
* direction:
−
** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=MHUWZNTUIIFHAS-DSSVUWSHSA-L
+
 
* common name:
 
* common name:
−
** dioleoyl phosphatidate
+
** 3-oxo-decanoyl-[acyl-carrier protein] synthase
−
* molecular weight:
+
** Beta-ketoacyl synthase
−
** 698.959   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
 
* Synonym(s):
 
* Synonym(s):
−
** 18:1-18:1-PA
 
−
** 1-18:1-2-18:1-phosphatidic acid
 
−
** 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphate
 
−
** 1-18:1-2-18:1-phosphatidate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-15068]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[PROTON]][c] '''+''' 1 [[MALONYL-ACP]][c] '''+''' 1 [[Octanoyl-ACPs]][c] '''=>''' 1 [[3-oxo-decanoyl-ACPs]][c] '''+''' 1 [[ACP]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
−
* [[RXN-15043]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 H+[c] '''+''' 1 a malonyl-[acp][c] '''+''' 1 an octanoyl-[acp][c] '''=>''' 1 a 3-oxo-decanoyl-[acp][c] '''+''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 CO2[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00009465001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[CHC_T00009465001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
== Pathways  ==
 +
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
 +
** '''31''' reactions found over '''31''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-original_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71627209 71627209]
+
{{#set: common name=3-oxo-decanoyl-[acyl-carrier protein] synthase}}
−
* CHEBI:
+
{{#set: common name=Beta-ketoacyl synthase}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83308 83308]
+
{{#set: ec number=EC-2.3.1.41}}
−
* HMDB : HMDB07865
+
{{#set: gene associated=CHC_T00009465001|CHC_T00009465001_1}}
−
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O}}
+
{{#set: in pathway=PWY-5971}}
−
{{#set: inchi key=InChIKey=MHUWZNTUIIFHAS-DSSVUWSHSA-L}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: common name=dioleoyl phosphatidate}}
+
{{#set: reconstruction source=annotation-original_genome|orthology-arabidopsis_thaliana|orthology-ectocarpus_siliculosus}}
−
{{#set: molecular weight=698.959    }}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: common name=18:1-18:1-PA|1-18:1-2-18:1-phosphatidic acid|1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphate|1-18:1-2-18:1-phosphatidate}}
+
−
{{#set: consumed by=RXN-15068}}
+
−
{{#set: produced by=RXN-15043}}
+

Latest revision as of 15:51, 23 May 2018

Reaction RXN-9527

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-oxo-decanoyl-[acyl-carrier protein] synthase
    • Beta-ketoacyl synthase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5971, palmitate biosynthesis II (bacteria and plants): PWY-5971
    • 31 reactions found over 31 reactions in the full pathway

Reconstruction information

External links

"3-oxo-decanoyl-[acyl-carrier protein] synthase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-9527&oldid=12331"