Difference between revisions of "PWY66-3"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] == * smiles: ** C(CC[N+]CCCCC[N+])[N+] * inchi key: ** InChIKey=QZBYOYPROV...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-3 PWY66-3] ==
−
* smiles:
+
−
** C(CC[N+]CCCCC[N+])[N+]
+
−
* inchi key:
+
−
** InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q
+
 
* common name:
 
* common name:
−
** aminopropylcadaverine
+
** cholesterol biosynthesis II (via 24,25-dihydrolanosterol)
−
* molecular weight:
+
* taxonomic range:
−
** 162.298   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
 
* Synonym(s):
 
* Synonym(s):
−
** N-3-aminopropyl-1,5-diaminopentane
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''15''' reactions found over '''22''' reactions in the full pathway
−
* [[RXN0-5217]]
+
* [[1.14.21.6-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[CHC_T00006481001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[PWY-5670]]
 +
** 0 associated gene:
 +
* [[RXN66-11]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009303001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN66-12]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009303001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN66-13]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009303001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN66-14]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00003466001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN66-15]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00010320001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[RXN66-16]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00010320001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[RXN66-17]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00010320001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[RXN66-18]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00003646001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN66-20]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00010320001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[RXN66-21]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00010320001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[RXN66-22]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00010320001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[RXN66-23]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00003646001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN66-323]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00006493001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-6132 PWY-6132]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-6132 PWY-6132]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-10 RXN66-10]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-19 RXN66-19]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-24 RXN66-24]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-25 RXN66-25]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=cholesterol biosynthesis II (via 24,25-dihydrolanosterol)}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246266 25246266]
+
{{#set: taxonomic range=TAX-33208}}
−
* CHEBI:
+
{{#set: reaction found=15}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64858 64858]
+
{{#set: total reaction=22}}
−
* LIGAND-CPD:
+
{{#set: completion rate=68.0}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16565 C16565]
+
−
* HMDB : HMDB12189
+
−
{{#set: smiles=C(CC[N+]CCCCC[N+])[N+]}}
+
−
{{#set: inchi key=InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q}}
+
−
{{#set: common name=aminopropylcadaverine}}
+
−
{{#set: molecular weight=162.298    }}
+
−
{{#set: common name=N-3-aminopropyl-1,5-diaminopentane}}
+
−
{{#set: produced by=RXN0-5217}}
+

Latest revision as of 15:00, 9 January 2019

Pathway PWY66-3

  • common name:
    • cholesterol biosynthesis II (via 24,25-dihydrolanosterol)
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

15 reactions found over 22 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PWY66-3&oldid=19693"