Difference between revisions of "P-COUMAROYL-COA"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00009087001_1 == * Synonym(s): == Reactions associated == * 3-ISOPROPYLMALISOM-RXN ** pantograph-galdieria.sulphuraria ** pantogr...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-COUMAROYL-COA P-COUMAROYL-COA] == |
| + | * smiles: | ||
| + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-] | ||
| + | * molecular weight: | ||
| + | ** 909.648 | ||
| + | * inchi key: | ||
| + | ** InChIKey=DMZOKBALNZWDKI-MATMFAIHSA-J | ||
| + | * common name: | ||
| + | ** 4-coumaroyl-CoA | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** p-coumaroyl-CoA | ||
| + | ** 4-hydroxycinnamoyl-CoA | ||
| + | ** 4-coumaryl-CoA | ||
| + | ** p-coumaryl-CoA | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-1101]] |
| − | + | * [[NARINGENIN-CHALCONE-SYNTHASE-RXN]] | |
| − | + | * [[RXN-11244]] | |
| − | + | * [[RXN-3142]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * [[RXN- | + | * [[4-COUMARATE--COA-LIGASE-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15499 15499] |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266584 45266584] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00223 C00223] | ||
| + | * HMDB : HMDB60153 | ||
| + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}} | ||
| + | {{#set: molecular weight=909.648 }} | ||
| + | {{#set: inchi key=InChIKey=DMZOKBALNZWDKI-MATMFAIHSA-J}} | ||
| + | {{#set: common name=4-coumaroyl-CoA}} | ||
| + | {{#set: common name=p-coumaroyl-CoA|4-hydroxycinnamoyl-CoA|4-coumaryl-CoA|p-coumaryl-CoA}} | ||
| + | {{#set: consumed by=RXN-1101|NARINGENIN-CHALCONE-SYNTHASE-RXN|RXN-11244|RXN-3142}} | ||
| + | {{#set: produced by=4-COUMARATE--COA-LIGASE-RXN}} | ||
Latest revision as of 15:08, 9 January 2019
Contents
Metabolite P-COUMAROYL-COA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
- molecular weight:
- 909.648
- inchi key:
- InChIKey=DMZOKBALNZWDKI-MATMFAIHSA-J
- common name:
- 4-coumaroyl-CoA
- Synonym(s):
- p-coumaroyl-CoA
- 4-hydroxycinnamoyl-CoA
- 4-coumaryl-CoA
- p-coumaryl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.
