Difference between revisions of "PWY-6681"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15678 CPD-15678] == * smiles: ** CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15678 CPD-15678] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6681 PWY-6681] ==
* smiles:
+
** CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=XBFQFVLNMJDDNG-DUPKWVSKSA-J
+
 
* common name:
 
* common name:
** 4-trans-3-oxo-undecenoyl-CoA
+
** neurosporaxanthin biosynthesis
* molecular weight:
+
* taxonomic range:
** 943.749   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154]
 
* Synonym(s):
 
* Synonym(s):
** 4E-3-oxo-undecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-14793]]
+
'''2''' reactions found over '''7''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-11989]]
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[CHC_T00003476001_1]]
 +
*** [[CHC_T00004955001_1]]
 +
*** [[CHC_T00004944001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-11999]]
 +
** 3 associated gene(s):
 +
*** [[CHC_T00004944001_1]]
 +
*** [[CHC_T00003476001_1]]
 +
*** [[CHC_T00004955001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11974 RXN-11974]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11976 RXN-11976]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11998 RXN-11998]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12000 RXN-12000]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12001 RXN-12001]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=neurosporaxanthin biosynthesis}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658908 90658908]
+
{{#set: taxonomic range=TAX-33154}}
{{#set: smiles=CCCCCCC=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction found=2}}
{{#set: inchi key=InChIKey=XBFQFVLNMJDDNG-DUPKWVSKSA-J}}
+
{{#set: total reaction=7}}
{{#set: common name=4-trans-3-oxo-undecenoyl-CoA}}
+
{{#set: completion rate=28.999999999999996}}
{{#set: molecular weight=943.749    }}
+
{{#set: common name=4E-3-oxo-undecenoyl-CoA}}
+
{{#set: consumed by=RXN-14793}}
+

Latest revision as of 15:01, 9 January 2019

Pathway PWY-6681

  • common name:
    • neurosporaxanthin biosynthesis
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

2 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links