Difference between revisions of "CPD-1301"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18085 CPD-18085] == * smiles: ** C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1301 CPD-1301] == |
* smiles: | * smiles: | ||
− | ** | + | ** C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3) |
+ | * molecular weight: | ||
+ | ** 699.633 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=RXWVHRYZTWZATH-XSLAGTTESA-J |
* common name: | * common name: | ||
− | ** | + | ** tetrahydropteroyl tri-L-glutamate |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** H4PteGlu3 |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-12730]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[HOMOCYSMET-RXN]] | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58140 58140] |
− | {{#set: smiles= | + | * PUBCHEM: |
− | {{#set: inchi key=InChIKey= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791999 49791999] |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04144 C04144] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.17625690.html 17625690] |
+ | * HMDB : HMDB12290 | ||
+ | {{#set: smiles=C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3)}} | ||
+ | {{#set: molecular weight=699.633 }} | ||
+ | {{#set: inchi key=InChIKey=RXWVHRYZTWZATH-XSLAGTTESA-J}} | ||
+ | {{#set: common name=tetrahydropteroyl tri-L-glutamate}} | ||
+ | {{#set: common name=H4PteGlu3}} | ||
+ | {{#set: produced by=RXN-12730}} | ||
+ | {{#set: reversible reaction associated=HOMOCYSMET-RXN}} |
Latest revision as of 15:03, 9 January 2019
Contents
Metabolite CPD-1301
- smiles:
- C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3)
- molecular weight:
- 699.633
- inchi key:
- InChIKey=RXWVHRYZTWZATH-XSLAGTTESA-J
- common name:
- tetrahydropteroyl tri-L-glutamate
- Synonym(s):
- H4PteGlu3
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3)" cannot be used as a page name in this wiki.