Difference between revisions of "2-KETO-6-AMINO-CAPROATE"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=TRPCAT-PWY TRPCAT-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-KETO-6-AMINO-CAPROATE 2-KETO-6-AMINO-CAPROATE] == |
− | * | + | * smiles: |
− | ** [ | + | ** C(CC(=O)C(=O)[O-])CC[N+] |
+ | * molecular weight: | ||
+ | ** 145.158 | ||
+ | * inchi key: | ||
+ | ** InChIKey=GWENQMVPLJAMAE-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 2-keto-6-aminocaproate |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2-oxo-6-aminohexanoate |
+ | ** 2-oxo-6-aminocaproate | ||
+ | ** 6-amino-2-oxohexanoate | ||
+ | ** α-keto-ε-aminocaproate | ||
+ | ** α-keto-ε-aminohexanoate | ||
+ | ** α-ketolysine | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-8163]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == Reaction(s) | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58183 58183] |
− | {{#set: common name= | + | * METABOLIGHTS : MTBLC58183 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201239 25201239] |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C03239 C03239] | ||
+ | * HMDB : HMDB12151 | ||
+ | {{#set: smiles=C(CC(=O)C(=O)[O-])CC[N+]}} | ||
+ | {{#set: molecular weight=145.158 }} | ||
+ | {{#set: inchi key=InChIKey=GWENQMVPLJAMAE-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=2-keto-6-aminocaproate}} | ||
+ | {{#set: common name=2-oxo-6-aminohexanoate|2-oxo-6-aminocaproate|6-amino-2-oxohexanoate|α-keto-ε-aminocaproate|α-keto-ε-aminohexanoate|α-ketolysine}} | ||
+ | {{#set: produced by=RXN-8163}} |
Latest revision as of 15:04, 9 January 2019
Contents
Metabolite 2-KETO-6-AMINO-CAPROATE
- smiles:
- C(CC(=O)C(=O)[O-])CC[N+]
- molecular weight:
- 145.158
- inchi key:
- InChIKey=GWENQMVPLJAMAE-UHFFFAOYSA-N
- common name:
- 2-keto-6-aminocaproate
- Synonym(s):
- 2-oxo-6-aminohexanoate
- 2-oxo-6-aminocaproate
- 6-amino-2-oxohexanoate
- α-keto-ε-aminocaproate
- α-keto-ε-aminohexanoate
- α-ketolysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CC(=O)C(=O)[O-])CC[N+" cannot be used as a page name in this wiki.