Difference between revisions of "PWY-6122"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11690 CPD-11690] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)O * inchi key: ** InChIKey=R...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11690 CPD-11690] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6122 PWY-6122] ==
* smiles:
+
** CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)O
+
* inchi key:
+
** InChIKey=RZRNAYUHWVFMIP-QJRAZLAKSA-N
+
 
* common name:
 
* common name:
** 1-oleoyl-sn-glycerol
+
** 5-aminoimidazole ribonucleotide biosynthesis II
* molecular weight:
+
* taxonomic range:
** 356.545   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* Synonym(s):
 
* Synonym(s):
** sn-glycerol 1-oleate
 
** mono-oleoylglycerol
 
** alpha-Monoolein
 
** glycerol oleate
 
** 1-oleylglycerol
 
** 1-monoolein
 
** mono-olein
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-15089]]
+
'''5''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[AIRS-RXN]]
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[CHC_T00008410001_1]]
 +
*** [[CHC_T00008410001]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
* [[FGAMSYN-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00008585001]]
 +
*** [[CHC_T00008585001_1]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[GARTRANSFORMYL2-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00006609001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[GLYRIBONUCSYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00000892001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[PRPPAMIDOTRANS-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009506001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12178130 12178130]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6122 PWY-6122]
* CHEMSPIDER:
+
{{#set: common name=5-aminoimidazole ribonucleotide biosynthesis II}}
** [http://www.chemspider.com/Chemical-Structure.4446588.html 4446588]
+
{{#set: taxonomic range=TAX-2157}}
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75757 75757]
+
{{#set: reaction found=5}}
* HMDB : HMDB11567
+
{{#set: total reaction=5}}
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)O}}
+
{{#set: completion rate=100.0}}
{{#set: inchi key=InChIKey=RZRNAYUHWVFMIP-QJRAZLAKSA-N}}
+
{{#set: common name=1-oleoyl-sn-glycerol}}
+
{{#set: molecular weight=356.545    }}
+
{{#set: common name=sn-glycerol 1-oleate|mono-oleoylglycerol|alpha-Monoolein|glycerol oleate|1-oleylglycerol|1-monoolein|mono-olein}}
+
{{#set: consumed by=RXN-15089}}
+

Latest revision as of 16:03, 9 January 2019

Pathway PWY-6122

  • common name:
    • 5-aminoimidazole ribonucleotide biosynthesis II
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

5 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links