Difference between revisions of "CPD-19160"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00010226001 == * left end position: ** 61569 * transcription direction: ** NEGATIVE * right end position: ** 63281 * centisome position: ** 96.0...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00010226001 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19160 CPD-19160] ==
* left end position:
+
* smiles:
** 61569
+
** CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* transcription direction:
+
* molecular weight:
** NEGATIVE
+
** 1041.936   
* right end position:
+
* inchi key:
** 63281
+
** InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J
* centisome position:
+
* common name:
** 96.07996   
+
** 3-oxo-(11Z)-octadecenoyl-CoA
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-oxo-18:1-Δ11-CoA
 +
** 3-oxo-11-cis-octadecenoyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[ASPARTATE--TRNA-LIGASE-RXN]]
+
* [[RXN-17787]]
** original_genome
+
== Reaction(s) known to produce the compound ==
***automated-name-match
+
* [[RXN-17786]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
* [[TRNA-CHARGING-PWY]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=61569}}
+
{{#set: smiles=CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: transcription direction=NEGATIVE}}
+
{{#set: molecular weight=1041.936    }}
{{#set: right end position=63281}}
+
{{#set: inchi key=InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J}}
{{#set: centisome position=96.07996    }}
+
{{#set: common name=3-oxo-(11Z)-octadecenoyl-CoA}}
{{#set: reaction associated=ASPARTATE--TRNA-LIGASE-RXN}}
+
{{#set: common name=3-oxo-18:1-Δ11-CoA|3-oxo-11-cis-octadecenoyl-CoA}}
{{#set: pathway associated=TRNA-CHARGING-PWY}}
+
{{#set: consumed by=RXN-17787}}
 +
{{#set: produced by=RXN-17786}}

Latest revision as of 15:06, 9 January 2019

Metabolite CPD-19160

  • smiles:
    • CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • molecular weight:
    • 1041.936
  • inchi key:
    • InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J
  • common name:
    • 3-oxo-(11Z)-octadecenoyl-CoA
  • Synonym(s):
    • 3-oxo-18:1-Δ11-CoA
    • 3-oxo-11-cis-octadecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.