Difference between revisions of "CPD-19160"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00010226001 == * left end position: ** 61569 * transcription direction: ** NEGATIVE * right end position: ** 63281 * centisome position: ** 96.0...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19160 CPD-19160] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
− | * | + | * molecular weight: |
− | ** | + | ** 1041.936 |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J |
− | * | + | * common name: |
− | ** | + | ** 3-oxo-(11Z)-octadecenoyl-CoA |
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-oxo-18:1-Δ11-CoA | ||
+ | ** 3-oxo-11-cis-octadecenoyl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-17787]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-17786]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | * [[ | + | |
== External links == | == External links == | ||
− | {{#set: | + | {{#set: smiles=CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | {{#set: | + | {{#set: molecular weight=1041.936 }} |
− | {{#set: | + | {{#set: inchi key=InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J}} |
− | {{#set: | + | {{#set: common name=3-oxo-(11Z)-octadecenoyl-CoA}} |
− | {{#set: | + | {{#set: common name=3-oxo-18:1-Δ11-CoA|3-oxo-11-cis-octadecenoyl-CoA}} |
− | {{#set: | + | {{#set: consumed by=RXN-17787}} |
+ | {{#set: produced by=RXN-17786}} |
Latest revision as of 15:06, 9 January 2019
Contents
Metabolite CPD-19160
- smiles:
- CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- molecular weight:
- 1041.936
- inchi key:
- InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J
- common name:
- 3-oxo-(11Z)-octadecenoyl-CoA
- Synonym(s):
- 3-oxo-18:1-Δ11-CoA
- 3-oxo-11-cis-octadecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.