Difference between revisions of "RXN-11838"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4618 CPD-4618] == * smiles: ** CC(=CCNC1(C2(=C(N=CN=1)N=CN2C3(C(C(C(C(O3)CO)O)O)O))))CO * i...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4618 CPD-4618] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11838 RXN-11838] ==
* smiles:
+
* direction:
** CC(=CCNC1(C2(=C(N=CN=1)N=CN2C3(C(C(C(C(O3)CO)O)O)O))))CO
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=HTDHRCLVWUEXIS-GIHYWFGSSA-N
+
** [http://enzyme.expasy.org/EC/5.4.99.24 EC-5.4.99.24]
* common name:
+
** cis-zeatin-7-N-glucoside
+
* molecular weight:
+
** 381.388   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-4733]]
+
** 1 [[23S-rRNA-uridine955-2504-2580]][c] '''=>''' 1 [[23S-rRNA-pseudouridine955-2504-2580]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 uridine955/2504/2580 in 23S rRNA[c] '''=>''' 1 a pseudouridine955/2504/2580 in 23S rRNA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00003130001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00006820001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244153 25244153]
+
{{#set: ec number=EC-5.4.99.24}}
* HMDB : HMDB12201
+
{{#set: gene associated=CHC_T00003130001_1|CHC_T00006820001_1}}
{{#set: smiles=CC(=CCNC1(C2(=C(N=CN=1)N=CN2C3(C(C(C(C(O3)CO)O)O)O))))CO}}
+
{{#set: in pathway=}}
{{#set: inchi key=InChIKey=HTDHRCLVWUEXIS-GIHYWFGSSA-N}}
+
{{#set: reconstruction category=orthology}}
{{#set: common name=cis-zeatin-7-N-glucoside}}
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria|orthology-ectocarpus_siliculosus}}
{{#set: molecular weight=381.388    }}
+
{{#set: reconstruction tool=pantograph}}
{{#set: produced by=RXN-4733}}
+

Latest revision as of 15:06, 9 January 2019

Reaction RXN-11838

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links