Difference between revisions of "ENT-KAUR-16-EN-19-OL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OXO-EICOSAPENTAENOYL-ACP 3-OXO-EICOSAPENTAENOYL-ACP] == * common name: ** a 3-oxo-docosapenta...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ENT-KAUR-16-EN-19-OL ENT-KAUR-16-EN-19-OL] == |
+ | * smiles: | ||
+ | ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC(C)2[CH]3CC4)))) | ||
+ | * molecular weight: | ||
+ | ** 288.472 | ||
+ | * inchi key: | ||
+ | ** InChIKey=TUJQVRFWMWRMIO-XRNRSJMDSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** ent-kaurenol |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** ent-kaur-16-en-19-ol |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-5242]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[1.14.13.78-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29611 29611] |
− | {{#set: consumed by=RXN- | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=443465 443465] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C11872 C11872] | ||
+ | * HMDB : HMDB36727 | ||
+ | {{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC(C)2[CH]3CC4))))}} | ||
+ | {{#set: molecular weight=288.472 }} | ||
+ | {{#set: inchi key=InChIKey=TUJQVRFWMWRMIO-XRNRSJMDSA-N}} | ||
+ | {{#set: common name=ent-kaurenol}} | ||
+ | {{#set: common name=ent-kaur-16-en-19-ol}} | ||
+ | {{#set: consumed by=RXN-5242}} | ||
+ | {{#set: produced by=1.14.13.78-RXN}} |
Latest revision as of 15:08, 9 January 2019
Contents
Metabolite ENT-KAUR-16-EN-19-OL
- smiles:
- C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC(C)2[CH]3CC4))))
- molecular weight:
- 288.472
- inchi key:
- InChIKey=TUJQVRFWMWRMIO-XRNRSJMDSA-N
- common name:
- ent-kaurenol
- Synonym(s):
- ent-kaur-16-en-19-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C4(CC3(C1)(CC[CH]2(C(C)(CO)CCCC(C)2[CH]3CC4))))" cannot be used as a page name in this wiki.