Difference between revisions of "CPD-9957"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPT-Synthases MPT-Synthases] == * common name: ** a small subunit of molybdopterin synthase * S...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPT-Synthases MPT-Synthases] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9957 CPD-9957] ==
 +
* smiles:
 +
** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)
 +
* molecular weight:
 +
** 797.255   
 +
* inchi key:
 +
** InChIKey=NPCOQXAVBJJZBQ-WJNLUYJISA-N
 
* common name:
 
* common name:
** a small subunit of molybdopterin synthase
+
** ubiquinol-9
 
* Synonym(s):
 
* Synonym(s):
 +
** ubiquinol(9)
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11361]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8342]]
+
* [[2.1.1.64-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a small subunit of molybdopterin synthase}}
+
* CHEBI:
{{#set: consumed by=RXN-11361}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84424 84424]
{{#set: produced by=RXN-8342}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45281170 45281170]
 +
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)}}
 +
{{#set: molecular weight=797.255    }}
 +
{{#set: inchi key=InChIKey=NPCOQXAVBJJZBQ-WJNLUYJISA-N}}
 +
{{#set: common name=ubiquinol-9}}
 +
{{#set: common name=ubiquinol(9)}}
 +
{{#set: produced by=2.1.1.64-RXN}}

Latest revision as of 16:10, 9 January 2019

Metabolite CPD-9957

  • smiles:
    • CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)
  • molecular weight:
    • 797.255
  • inchi key:
    • InChIKey=NPCOQXAVBJJZBQ-WJNLUYJISA-N
  • common name:
    • ubiquinol-9
  • Synonym(s):
    • ubiquinol(9)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links