Difference between revisions of "Protein-L-lysine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == * smiles: ** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1) * inc...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-lysine Protein-L-lysine] ==
* smiles:
+
** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)
+
* inchi key:
+
** InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K
+
 
* common name:
 
* common name:
** shikimate 3-phosphate
+
** a [protein]-L-lysine
* molecular weight:
+
** 251.109   
+
 
* Synonym(s):
 
* Synonym(s):
** shikimate 5-phosphate
+
** an [enzyme]-lysine
** shikimate-5-P
+
** 3-phosphoshikimate
+
** shikimate-3-P
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-15561]]
 +
* [[RXN-15560]]
 +
* [[RXN-16313]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.4.19.12-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[2.5.1.19-RXN]]
 
* [[SHIKIMATE-KINASE-RXN]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a [protein]-L-lysine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14506806 14506806]
+
{{#set: common name=an [enzyme]-lysine}}
* CHEBI:
+
{{#set: consumed by=RXN-15561|RXN-15560|RXN-16313}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=145989 145989]
+
{{#set: produced by=3.4.19.12-RXN}}
* BIGG : skm5p
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C03175 C03175]
+
{{#set: smiles=C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)}}
+
{{#set: inchi key=InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K}}
+
{{#set: common name=shikimate 3-phosphate}}
+
{{#set: molecular weight=251.109    }}
+
{{#set: common name=shikimate 5-phosphate|shikimate-5-P|3-phosphoshikimate|shikimate-3-P}}
+
{{#set: consumed or produced by=2.5.1.19-RXN|SHIKIMATE-KINASE-RXN}}
+

Latest revision as of 15:10, 9 January 2019

Metabolite Protein-L-lysine

  • common name:
    • a [protein]-L-lysine
  • Synonym(s):
    • an [enzyme]-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [protein]-L-lysine" cannot be used as a page name in this wiki.
"an [enzyme]-lysine" cannot be used as a page name in this wiki.