Difference between revisions of "PWY-7288"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FECOSTEROL FECOSTEROL] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(O)CCC(C)1C=2...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FECOSTEROL FECOSTEROL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7288 PWY-7288] ==
* smiles:
+
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(O)CCC(C)1C=2CCC(C)34))))
+
* inchi key:
+
** InChIKey=SLQKYSPHBZMASJ-QKPORZECSA-N
+
 
* common name:
 
* common name:
** fecosterol
+
** fatty acid β-oxidation (peroxisome, yeast)
* molecular weight:
+
* taxonomic range:
** 398.671   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 
* Synonym(s):
 
* Synonym(s):
** 24-methylene-5α-cholest-8-en-3β-ol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN3O-203]]
+
'''3''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[ACYLCOASYN-RXN]]
== Reaction(s) of unknown directionality ==
+
** 6 associated gene(s):
 +
*** [[CHC_T00009428001_1]]
 +
*** [[CHC_T00008811001]]
 +
*** [[CHC_T00008811001_1]]
 +
*** [[CHC_T00008160001_1]]
 +
*** [[CHC_T00008500001_1]]
 +
*** [[CHC_T00009428001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[KETOACYLCOATHIOL-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009422001_1]]
 +
*** [[CHC_T00009349001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[RXN-11026]]
 +
** 10 associated gene(s):
 +
*** [[CHC_T00009531001]]
 +
*** [[CHC_T00008400001_1]]
 +
*** [[CHC_T00008400001]]
 +
*** [[CHC_T00008935001_1]]
 +
*** [[CHC_T00008935001]]
 +
*** [[CHC_T00009142001]]
 +
*** [[CHC_T00009531001_1]]
 +
*** [[CHC_T00007910001_1]]
 +
*** [[CHC_T00009142001_1]]
 +
*** [[CHC_T00008478001_1]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7699 RXN-7699]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-485 RXN66-485]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMST01030095
+
{{#set: common name=fatty acid β-oxidation (peroxisome, yeast)}}
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440371 440371]
+
{{#set: reaction found=3}}
* CHEBI:
+
{{#set: total reaction=5}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17038 17038]
+
{{#set: completion rate=60.0}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C04525 C04525]
+
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(O)CCC(C)1C=2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=SLQKYSPHBZMASJ-QKPORZECSA-N}}
+
{{#set: common name=fecosterol}}
+
{{#set: molecular weight=398.671    }}
+
{{#set: common name=24-methylene-5α-cholest-8-en-3β-ol}}
+
{{#set: consumed by=RXN3O-203}}
+

Latest revision as of 15:10, 9 January 2019

Pathway PWY-7288

  • common name:
    • fatty acid β-oxidation (peroxisome, yeast)
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

3 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links