Difference between revisions of "PHOSMANMUT-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12673 CPD-12673] == * smiles: ** C(=O)([O-])C(O)C(O)C(O)CCl * inchi key: ** InChIKey=IJQSOC...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PHOSMANMUT-RXN PHOSMANMUT-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** phosphomannomutase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/5.4.2.8 EC-5.4.2.8] |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[MANNOSE-1P]][c] '''<=>''' 1 [[CPD-15979]][c] |
− | == | + | * With common name(s): |
+ | ** 1 α-D-mannose 1-phosphate[c] '''<=>''' 1 D-mannopyranose 6-phosphate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00009219001]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[CHC_T00003000001_1]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Gene: [[CHC_T00009219001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | == Pathways == | ||
+ | * [[PWY-7456]], β-(1,4)-mannan degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7456 PWY-7456] | ||
+ | ** '''2''' reactions found over '''7''' reactions in the full pathway | ||
+ | * [[PWY-5659]], GDP-mannose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5659 PWY-5659] | ||
+ | ** '''4''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-882]], L-ascorbate biosynthesis I (L-galactose pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-882 PWY-882] | ||
+ | ** '''6''' reactions found over '''8''' reactions in the full pathway | ||
+ | * [[PWY-7586]], β-1,4-D-mannosyl-N-acetyl-D-glucosamine degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7586 PWY-7586] | ||
+ | ** '''2''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11140 11140] |
− | {{#set: | + | * UNIPROT: |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P26276 P26276] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P29955 P29955] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P24175 P24175] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P07283 P07283] |
+ | ** [http://www.uniprot.org/uniprot/P47723 P47723] | ||
+ | ** [http://www.uniprot.org/uniprot/Q57842 Q57842] | ||
+ | ** [http://www.uniprot.org/uniprot/P47299 P47299] | ||
+ | ** [http://www.uniprot.org/uniprot/Q59428 Q59428] | ||
+ | ** [http://www.uniprot.org/uniprot/Q06951 Q06951] | ||
+ | ** [http://www.uniprot.org/uniprot/Q49913 Q49913] | ||
+ | ** [http://www.uniprot.org/uniprot/P75050 P75050] | ||
+ | ** [http://www.uniprot.org/uniprot/Q51847 Q51847] | ||
+ | * LIGAND-RXN: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?R01818 R01818] | ||
+ | {{#set: direction=REVERSIBLE}} | ||
+ | {{#set: common name=phosphomannomutase}} | ||
+ | {{#set: ec number=EC-5.4.2.8}} | ||
+ | {{#set: gene associated=CHC_T00009219001|CHC_T00003000001_1|CHC_T00009219001_1}} | ||
+ | {{#set: in pathway=PWY-7456|PWY-5659|PWY-882|PWY-7586}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=orthology-galdieria.sulphuraria|annotation-original_genome|orthology-arabidopsis_thaliana|orthology-ectocarpus_siliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 15:10, 9 January 2019
Contents
Reaction PHOSMANMUT-RXN
- direction:
- REVERSIBLE
- common name:
- phosphomannomutase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 MANNOSE-1P[c] <=> 1 CPD-15979[c]
- With common name(s):
- 1 α-D-mannose 1-phosphate[c] <=> 1 D-mannopyranose 6-phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00009219001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
- Gene: CHC_T00003000001_1
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00009219001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana
Pathways
- PWY-7456, β-(1,4)-mannan degradation: PWY-7456
- 2 reactions found over 7 reactions in the full pathway
- PWY-5659, GDP-mannose biosynthesis: PWY-5659
- 4 reactions found over 4 reactions in the full pathway
- PWY-882, L-ascorbate biosynthesis I (L-galactose pathway): PWY-882
- 6 reactions found over 8 reactions in the full pathway
- PWY-7586, β-1,4-D-mannosyl-N-acetyl-D-glucosamine degradation: PWY-7586
- 2 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-arabidopsis_thaliana
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
- Category: annotation
- Source: annotation-original_genome
- Tool: pathwaytools
- Source: annotation-original_genome
External links
- RHEA:
- UNIPROT:
- LIGAND-RXN: