Difference between revisions of "CHC T00009453001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1086 CPD-1086] == * smiles: ** C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-] * in...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00009453001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN-1882]] | |
− | * [[ | + | ** Source: [[orthology-galdieria.sulphuraria]] |
− | == | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5115]] | ||
+ | * [[PWY4FS-13]] | ||
+ | * [[PWY-882]] | ||
+ | * [[PWY4FS-12]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=RXN-1882}} | |
− | + | {{#set: pathway associated=PWY-5115|PWY4FS-13|PWY-882|PWY4FS-12}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 15:09, 9 January 2019
Gene CHC_T00009453001_1
- Synonym(s):
Reactions associated
- Reaction: RXN-1882
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana