Difference between revisions of "CPD-12673"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HOMOSERKIN-RXN HOMOSERKIN-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expa...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=HOMOSERKIN-RXN HOMOSERKIN-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12673 CPD-12673] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(=O)([O-])C(O)C(O)C(O)CCl
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/2.7.1.39 EC-2.7.1.39]
+
** 183.568   
 +
* inchi key:
 +
** InChIKey=IJQSOCFSKCENOW-BXXZVTAOSA-M
 +
* common name:
 +
** 5-chloro-5-deoxy-D-ribonate
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-11717]]
** 1 [[HOMO-SER]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[O-PHOSPHO-L-HOMOSERINE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 L-homoserine[c] '''+''' 1 ATP[c] '''=>''' 1 O-phospho-L-homoserine[c] '''+''' 1 H+[c] '''+''' 1 ADP[c]
+
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
* [[PWY-702]], L-methionine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-702 PWY-702]
+
** '''4''' reactions found over '''6''' reactions in the full pathway
+
* [[HOMOSER-THRESYN-PWY]], L-threonine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=HOMOSER-THRESYN-PWY HOMOSER-THRESYN-PWY]
+
** '''2''' reactions found over '''2''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[gap-filling]]:
+
** [[meneco]]:
+
*** [[added for gapfilling]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
* PUBCHEM:
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13985 13985]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859707 49859707]
* LIGAND-RXN:
+
{{#set: smiles=C(=O)([O-])C(O)C(O)C(O)CCl}}
** [http://www.genome.jp/dbget-bin/www_bget?R01771 R01771]
+
{{#set: molecular weight=183.568    }}
* UNIPROT:
+
{{#set: inchi key=InChIKey=IJQSOCFSKCENOW-BXXZVTAOSA-M}}
** [http://www.uniprot.org/uniprot/P27722 P27722]
+
{{#set: common name=5-chloro-5-deoxy-D-ribonate}}
** [http://www.uniprot.org/uniprot/Q9PIZ3 Q9PIZ3]
+
{{#set: consumed by=RXN-11717}}
** [http://www.uniprot.org/uniprot/P04948 P04948]
+
** [http://www.uniprot.org/uniprot/Q9UZV7 Q9UZV7]
+
** [http://www.uniprot.org/uniprot/Q9CGD7 Q9CGD7]
+
** [http://www.uniprot.org/uniprot/P44504 P44504]
+
** [http://www.uniprot.org/uniprot/P52991 P52991]
+
** [http://www.uniprot.org/uniprot/P00547 P00547]
+
** [http://www.uniprot.org/uniprot/P07128 P07128]
+
** [http://www.uniprot.org/uniprot/P17423 P17423]
+
** [http://www.uniprot.org/uniprot/P73646 P73646]
+
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: ec number=EC-2.7.1.39}}
+
{{#set: in pathway=PWY-702|HOMOSER-THRESYN-PWY}}
+
{{#set: reconstruction category=gap-filling}}
+
{{#set: reconstruction tool=meneco}}
+
{{#set: reconstruction source=added for gapfilling}}
+

Latest revision as of 15:12, 9 January 2019

Metabolite CPD-12673

  • smiles:
    • C(=O)([O-])C(O)C(O)C(O)CCl
  • molecular weight:
    • 183.568
  • inchi key:
    • InChIKey=IJQSOCFSKCENOW-BXXZVTAOSA-M
  • common name:
    • 5-chloro-5-deoxy-D-ribonate
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])C(O)C(O)C(O)CCl" cannot be used as a page name in this wiki.