Difference between revisions of "CPD-4125"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Chalcones Chalcones] == * common name: ** a chalcone * Synonym(s): ** a chalconoid == Reaction...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Chalcones Chalcones] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4125 CPD-4125] ==
 +
* smiles:
 +
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 +
* molecular weight:
 +
** 412.698   
 +
* inchi key:
 +
** InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N
 
* common name:
 
* common name:
** a chalcone
+
** avenasterol
 
* Synonym(s):
 
* Synonym(s):
** a chalconoid
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-4209]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[CHALCONE-ISOMERASE-RXN]]
 
 
== External links  ==
 
== External links  ==
{{#set: common name=a chalcone}}
+
* PUBCHEM:
{{#set: common name=a chalconoid}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12795736 12795736]
{{#set: consumed or produced by=CHALCONE-ISOMERASE-RXN}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15782 C15782]
 +
* HMDB : HMDB06851
 +
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: molecular weight=412.698    }}
 +
{{#set: inchi key=InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N}}
 +
{{#set: common name=avenasterol}}
 +
{{#set: consumed by=RXN-4209}}

Latest revision as of 15:12, 9 January 2019

Metabolite CPD-4125

  • smiles:
    • CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • molecular weight:
    • 412.698
  • inchi key:
    • InChIKey=MCWVPSBQQXUCTB-OQTIOYDCSA-N
  • common name:
    • avenasterol
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.