Difference between revisions of "GLC-6-P"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008570001 == * left end position: ** 31925 * transcription direction: ** NEGATIVE * right end position: ** 33142 * centisome position: ** 13.1...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O |
| − | * | + | * molecular weight: |
| − | ** | + | ** 258.121 |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L |
| − | * | + | * common name: |
| − | ** | + | ** β-D-glucose 6-phosphate |
* Synonym(s): | * Synonym(s): | ||
| + | ** β-D-glucose-6-P | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN66-579]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | * [[RXN-16996]] |
| − | * [[ | + | * [[BETA-PHOSPHOGLUCOMUTASE-RXN]] |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * BIGG : g6p |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01172 C01172] |
| − | {{#set: | + | * HMDB : HMDB03498 |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.10239176.html 10239176] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58247 58247] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21604865 21604865] | ||
| + | {{#set: smiles=C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O}} | ||
| + | {{#set: molecular weight=258.121 }} | ||
| + | {{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L}} | ||
| + | {{#set: common name=β-D-glucose 6-phosphate}} | ||
| + | {{#set: common name=β-D-glucose-6-P}} | ||
| + | {{#set: consumed by=RXN66-579}} | ||
| + | {{#set: reversible reaction associated=RXN-16996|BETA-PHOSPHOGLUCOMUTASE-RXN}} | ||
Latest revision as of 15:12, 9 January 2019
Contents
Metabolite GLC-6-P
- smiles:
- C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O
- molecular weight:
- 258.121
- inchi key:
- InChIKey=NBSCHQHZLSJFNQ-VFUOTHLCSA-L
- common name:
- β-D-glucose 6-phosphate
- Synonym(s):
- β-D-glucose-6-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O" cannot be used as a page name in this wiki.
