Difference between revisions of "CPD-7109"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-N-Ac-L-Serine N-terminal-N-Ac-L-Serine] == * common name: ** an N-terminal Nα-...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7109 CPD-7109] == |
+ | * smiles: | ||
+ | ** CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C | ||
+ | * molecular weight: | ||
+ | ** 277.339 | ||
+ | * inchi key: | ||
+ | ** InChIKey=LWLGKGHHVBVDKB-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** 4-prenylphlorisovalerophenone |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** PPIVP |
+ | ** compound-X | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-7810]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-7811]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200610 25200610] |
− | {{#set: produced by=RXN- | + | {{#set: smiles=CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C}} |
+ | {{#set: molecular weight=277.339 }} | ||
+ | {{#set: inchi key=InChIKey=LWLGKGHHVBVDKB-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=4-prenylphlorisovalerophenone}} | ||
+ | {{#set: common name=PPIVP|compound-X}} | ||
+ | {{#set: consumed by=RXN-7810}} | ||
+ | {{#set: produced by=RXN-7811}} |
Latest revision as of 15:12, 9 January 2019
Contents
Metabolite CPD-7109
- smiles:
- CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C
- molecular weight:
- 277.339
- inchi key:
- InChIKey=LWLGKGHHVBVDKB-UHFFFAOYSA-M
- common name:
- 4-prenylphlorisovalerophenone
- Synonym(s):
- PPIVP
- compound-X
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C" cannot be used as a page name in this wiki.