Difference between revisions of "HYDROXY-915-DIOXOPROSTA-13-ENOATE"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008625001 == * left end position: ** 23224 * transcription direction: ** NEGATIVE * right end position: ** 26850 * centisome position: ** 10.8...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDROXY-915-DIOXOPROSTA-13-ENOATE HYDROXY-915-DIOXOPROSTA-13-ENOATE] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCCC(=O)C=CC1(C(CC=CCCCC(=O)[O-])C(=O)CC(O)1) |
− | * | + | * molecular weight: |
− | ** | + | ** 349.446 |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=YRTJDWROBKPZNV-KMXMBPPJSA-M |
− | * | + | * common name: |
− | ** | + | ** 15-dehydro-prostaglandin E2 |
* Synonym(s): | * Synonym(s): | ||
+ | ** (5Z,13E)-11α-hydroxy-9,15-dioxoprosta-5,13-dienoate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[1.1.1.141-RXN]] | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57400 57400] |
− | {{#set: | + | * CAS : 26441-05-4 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: reaction associated= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244714 25244714] |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C04707 C04707] | ||
+ | * HMDB : HMDB03175 | ||
+ | {{#set: smiles=CCCCCC(=O)C=CC1(C(CC=CCCCC(=O)[O-])C(=O)CC(O)1)}} | ||
+ | {{#set: molecular weight=349.446 }} | ||
+ | {{#set: inchi key=InChIKey=YRTJDWROBKPZNV-KMXMBPPJSA-M}} | ||
+ | {{#set: common name=15-dehydro-prostaglandin E2}} | ||
+ | {{#set: common name=(5Z,13E)-11α-hydroxy-9,15-dioxoprosta-5,13-dienoate}} | ||
+ | {{#set: reversible reaction associated=1.1.1.141-RXN}} |
Latest revision as of 15:13, 9 January 2019
Contents
Metabolite HYDROXY-915-DIOXOPROSTA-13-ENOATE
- smiles:
- CCCCCC(=O)C=CC1(C(CC=CCCCC(=O)[O-])C(=O)CC(O)1)
- molecular weight:
- 349.446
- inchi key:
- InChIKey=YRTJDWROBKPZNV-KMXMBPPJSA-M
- common name:
- 15-dehydro-prostaglandin E2
- Synonym(s):
- (5Z,13E)-11α-hydroxy-9,15-dioxoprosta-5,13-dienoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC(=O)C=CC1(C(CC=CCCCC(=O)[O-])C(=O)CC(O)1)" cannot be used as a page name in this wiki.