Difference between revisions of "PWY-7250"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] == * smiles: ** C(=CC1(=CC=C(O)C=C1))CO * inchi key: ** InCh...")
 
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7250 PWY-7250] ==
−
* smiles:
+
−
** C(=CC1(=CC=C(O)C=C1))CO
+
−
* inchi key:
+
−
** InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N
+
 
* common name:
 
* common name:
−
** 4-coumaryl alcohol
+
** [2Fe-2S] iron-sulfur cluster biosynthesis
−
* molecular weight:
+
* taxonomic range:
−
** 150.177   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 
* Synonym(s):
 
* Synonym(s):
−
** p-coumaryl alcohol
+
** [Fe-S] cluster biosynthesis
 +
** [2Fe-2S] cluster biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''8''' reactions found over '''10''' reactions in the full pathway
−
* [[RXN-1102]]
+
* [[RXN-14381]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[CHC_T00009307001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[RXN-14384]]
 +
** 3 associated gene(s):
 +
*** [[CHC_T00008053001_1]]
 +
*** [[CHC_T00000657001_1]]
 +
*** [[CHC_T00009510001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-14385]]
 +
** 3 associated gene(s):
 +
*** [[CHC_T00009510001_1]]
 +
*** [[CHC_T00008053001_1]]
 +
*** [[CHC_T00000657001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-14386]]
 +
** 3 associated gene(s):
 +
*** [[CHC_T00000657001_1]]
 +
*** [[CHC_T00008053001_1]]
 +
*** [[CHC_T00009510001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-14389]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00008003001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[RXN-14390]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00008003001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[RXN-14391]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00008003001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[RXN-15881]]
 +
** 3 associated gene(s):
 +
*** [[CHC_T00009510001_1]]
 +
*** [[CHC_T00000657001_1]]
 +
*** [[CHC_T00008053001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14387 RXN-14387]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14388 RXN-14388]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=[2Fe-2S] iron-sulfur cluster biosynthesis}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280535 5280535]
+
{{#set: taxonomic range=TAX-2759}}
−
* CHEMSPIDER:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://www.chemspider.com/Chemical-Structure.4444166.html 4444166]
+
{{#set: taxonomic range=TAX-2157}}
−
* CHEBI:
+
{{#set: common name=[Fe-S] cluster biosynthesis|[2Fe-2S] cluster biosynthesis}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28386 28386]
+
{{#set: reaction found=8}}
−
* LIGAND-CPD:
+
{{#set: total reaction=10}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02646 C02646]
+
{{#set: completion rate=80.0}}
−
* HMDB : HMDB03654
+
−
{{#set: smiles=C(=CC1(=CC=C(O)C=C1))CO}}
+
−
{{#set: inchi key=InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N}}
+
−
{{#set: common name=4-coumaryl alcohol}}
+
−
{{#set: molecular weight=150.177    }}
+
−
{{#set: common name=p-coumaryl alcohol}}
+
−
{{#set: produced by=RXN-1102}}
+

Latest revision as of 15:09, 9 January 2019

Pathway PWY-7250

  • common name:
    • [2Fe-2S] iron-sulfur cluster biosynthesis
  • taxonomic range:
  • Synonym(s):
    • [Fe-S] cluster biosynthesis
    • [2Fe-2S] cluster biosynthesis

Reaction(s) found

8 reactions found over 10 reactions in the full pathway

Reaction(s) not found

External links

"2Fe-2S] iron-sulfur cluster biosynthesis" cannot be used as a page name in this wiki.


  • "Fe-S] cluster biosynthesis" cannot be used as a page name in this wiki.
  • "2Fe-2S] cluster biosynthesis" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PWY-7250&oldid=19897"