Difference between revisions of "CPD-9957"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008575001 == * left end position: ** 166944 * transcription direction: ** NEGATIVE * right end position: ** 168494 * centisome position: ** 37...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9957 CPD-9957] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1) |
| − | * | + | * molecular weight: |
| − | ** | + | ** 797.255 |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=NPCOQXAVBJJZBQ-WJNLUYJISA-N |
| − | * | + | * common name: |
| − | ** | + | ** ubiquinol-9 |
* Synonym(s): | * Synonym(s): | ||
| + | ** ubiquinol(9) | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[2.1.1.64-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84424 84424] |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45281170 45281170] |
| − | {{#set: | + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)}} |
| − | {{#set: | + | {{#set: molecular weight=797.255 }} |
| + | {{#set: inchi key=InChIKey=NPCOQXAVBJJZBQ-WJNLUYJISA-N}} | ||
| + | {{#set: common name=ubiquinol-9}} | ||
| + | {{#set: common name=ubiquinol(9)}} | ||
| + | {{#set: produced by=2.1.1.64-RXN}} | ||
Latest revision as of 15:10, 9 January 2019
Contents
Metabolite CPD-9957
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)
- molecular weight:
- 797.255
- inchi key:
- InChIKey=NPCOQXAVBJJZBQ-WJNLUYJISA-N
- common name:
- ubiquinol-9
- Synonym(s):
- ubiquinol(9)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
