Difference between revisions of "RXN0-5468"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=8-AMINO-7-OXONONANOATE 8-AMINO-7-OXONONANOATE] == * smiles: ** CC(C(CCCCCC([O-])=O)=O)[N+] * in...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5468 RXN0-5468] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** peroxiredoxin, PRX3 |
− | * | + | ** peroxiredoxin, PRX1 |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/1.11.1.15 EC-1.11.1.15] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[Red-Thioredoxin]][c] '''+''' 1 [[Alkyl-Hydro-Peroxides]][c] '''=>''' 1 [[Ox-Thioredoxin]][c] '''+''' 1 [[Alcohols]][c] '''+''' 1 [[WATER]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 a reduced thioredoxin[c] '''+''' 1 an organic hydroperoxide[c] '''=>''' 1 an oxidized thioredoxin[c] '''+''' 1 an alcohol[c] '''+''' 1 H2O[c] |
− | * [[ | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00002035001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | * Gene: [[CHC_T00003196001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | * Gene: [[CHC_T00010097001]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[CHC_T00009369001]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=peroxiredoxin, PRX3}} | |
− | + | {{#set: common name=peroxiredoxin, PRX1}} | |
− | + | {{#set: ec number=EC-1.11.1.15}} | |
− | + | {{#set: gene associated=CHC_T00002035001_1|CHC_T00003196001_1|CHC_T00010097001|CHC_T00009369001}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=orthology-galdieria.sulphuraria|annotation-original_genome}} | |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 16:15, 9 January 2019
Contents
Reaction RXN0-5468
- direction:
- LEFT-TO-RIGHT
- common name:
- peroxiredoxin, PRX3
- peroxiredoxin, PRX1
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Red-Thioredoxin[c] + 1 Alkyl-Hydro-Peroxides[c] => 1 Ox-Thioredoxin[c] + 1 Alcohols[c] + 1 WATER[c]
- With common name(s):
- 1 a reduced thioredoxin[c] + 1 an organic hydroperoxide[c] => 1 an oxidized thioredoxin[c] + 1 an alcohol[c] + 1 H2O[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00002035001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00003196001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00010097001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
- Gene: CHC_T00009369001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
- Category: annotation
- Source: annotation-original_genome
- Tool: pathwaytools
- Source: annotation-original_genome