Difference between revisions of "CPD-1086"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8631 RXN-8631] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/4....")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8631 RXN-8631] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1086 CPD-1086] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-]
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/4.1.2.13 EC-4.1.2.13]
+
** 354.213   
 +
* inchi key:
 +
** InChIKey=RQRINYISXYAZKL-RPDRRWSUSA-L
 +
* common name:
 +
** 5-amino-6-(5-phospho-D-ribitylamino)uracil
 
* Synonym(s):
 
* Synonym(s):
 +
** 5-amino-6-(5'-phosphoribitylamino)uracil
 +
** 5-amino-6-(5-phosphoribitylamino)uracil
 +
** 5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione 5'-phosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[FRU1P]][c] '''=>''' 1 [[GLYCERALD]][c] '''+''' 1 [[DIHYDROXY-ACETONE-PHOSPHATE]][c]
+
* [[RIBOFLAVINSYNREDUC-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 β-D-fructofuranose 1-phosphate[c] '''=>''' 1 D-glyceraldehyde[c] '''+''' 1 glycerone phosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00008586001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
* [[PWY66-373]], sucrose degradation V (sucrose α-glucosidase): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-373 PWY66-373]
+
−
** '''2''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* CHEBI:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30851 30851]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58421 58421]
−
* LIGAND-RXN:
+
* BIGG : 5aprbu
−
** [http://www.genome.jp/dbget-bin/www_bget?R02568 R02568]
+
* PUBCHEM:
−
{{#set: direction=LEFT-TO-RIGHT}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266638 45266638]
−
{{#set: ec number=EC-4.1.2.13}}
+
* LIGAND-CPD:
−
{{#set: gene associated=CHC_T00008586001_1}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04454 C04454]
−
{{#set: in pathway=PWY66-373}}
+
* HMDB : HMDB03841
−
{{#set: reconstruction category=orthology}}
+
{{#set: smiles=C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-]}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=354.213    }}
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
{{#set: inchi key=InChIKey=RQRINYISXYAZKL-RPDRRWSUSA-L}}
 +
{{#set: common name=5-amino-6-(5-phospho-D-ribitylamino)uracil}}
 +
{{#set: common name=5-amino-6-(5'-phosphoribitylamino)uracil|5-amino-6-(5-phosphoribitylamino)uracil|5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione 5'-phosphate}}
 +
{{#set: produced by=RIBOFLAVINSYNREDUC-RXN}}

Latest revision as of 15:10, 9 January 2019

Metabolite CPD-1086

  • smiles:
    • C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-]
  • molecular weight:
    • 354.213
  • inchi key:
    • InChIKey=RQRINYISXYAZKL-RPDRRWSUSA-L
  • common name:
    • 5-amino-6-(5-phospho-D-ribitylamino)uracil
  • Synonym(s):
    • 5-amino-6-(5'-phosphoribitylamino)uracil
    • 5-amino-6-(5-phosphoribitylamino)uracil
    • 5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione 5'-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-1086&oldid=19911"