Difference between revisions of "CPD-4575"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLT GLT] == * smiles: ** C(CCC(C(=O)[O-])[N+])([O-])=O * inchi key: ** InChIKey=WHUUTDBJXJRKMK-...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4575 CPD-4575] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(CO)(C)C(O)CCC(C)1C=2CCC(C)34)))) |
+ | * molecular weight: | ||
+ | ** 428.697 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=LEUVIESGHNFBEK-WKYRUEGDSA-N |
* common name: | * common name: | ||
− | ** | + | ** 4α-hydroxymethyl-4β-methyl-5α-cholesta-8,24-dien-3β-ol |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN66-311]] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN66-310]] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87289 87289] |
− | * | + | * PUBCHEM: |
− | {{#set: smiles=C | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298936 22298936] |
− | + | * HMDB : HMDB12170 | |
− | + | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(CO)(C)C(O)CCC(C)1C=2CCC(C)34))))}} | |
− | {{#set: molecular weight= | + | {{#set: molecular weight=428.697 }} |
− | {{#set: | + | {{#set: inchi key=InChIKey=LEUVIESGHNFBEK-WKYRUEGDSA-N}} |
− | {{#set: | + | {{#set: common name=4α-hydroxymethyl-4β-methyl-5α-cholesta-8,24-dien-3β-ol}} |
− | {{#set: | + | {{#set: consumed by=RXN66-311}} |
− | {{#set: | + | {{#set: produced by=RXN66-310}} |
Latest revision as of 15:10, 9 January 2019
Contents
Metabolite CPD-4575
- smiles:
- CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(CO)(C)C(O)CCC(C)1C=2CCC(C)34))))
- molecular weight:
- 428.697
- inchi key:
- InChIKey=LEUVIESGHNFBEK-WKYRUEGDSA-N
- common name:
- 4α-hydroxymethyl-4β-methyl-5α-cholesta-8,24-dien-3β-ol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(CO)(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.