Difference between revisions of "PWY-7204"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFO-CYSTEINE SULFO-CYSTEINE] == * smiles: ** C(C([N+])C(=O)[O-])SS([O-])(=O)=O * inchi key: *...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7204 PWY-7204] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** pyridoxal 5'-phosphate salvage II (plants) |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** vitamin B6 salvage (plants) |
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''8''' reactions found over '''9''' reactions in the full pathway | |
| − | == Reaction(s) | + | * [[3.1.3.74-RXN]] |
| − | * [ | + | ** 1 associated gene(s): |
| + | *** [[CHC_T00008718001]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-original_genome]] | ||
| + | * [[PMPOXI-RXN]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[CHC_T00008142001_1]] | ||
| + | *** [[CHC_T00006254001_1]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | * [[PNKIN-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[CHC_T00004634001_1]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | * [[PNPOXI-RXN]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[CHC_T00008142001_1]] | ||
| + | *** [[CHC_T00006254001_1]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | * [[PYRAMKIN-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[CHC_T00004634001_1]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | * [[PYRIDOXKIN-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[CHC_T00004634001_1]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | * [[RXN-14046]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[CHC_T00008718001]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-original_genome]] | ||
| + | * [[RXN-14181]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[CHC_T00008718001]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-original_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXINE-4-DEHYDROGENASE-RXN PYRIDOXINE-4-DEHYDROGENASE-RXN] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=pyridoxal 5'-phosphate salvage II (plants)}} | |
| − | + | {{#set: taxonomic range=TAX-33090}} | |
| − | + | {{#set: common name=vitamin B6 salvage (plants)}} | |
| − | + | {{#set: reaction found=8}} | |
| − | + | {{#set: total reaction=9}} | |
| − | + | {{#set: completion rate=89.0}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 16:16, 9 January 2019
Pathway PWY-7204
- common name:
- pyridoxal 5'-phosphate salvage II (plants)
- taxonomic range:
- Synonym(s):
- vitamin B6 salvage (plants)
Reaction(s) found
8 reactions found over 9 reactions in the full pathway
- 3.1.3.74-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- PMPOXI-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- PNKIN-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- PNPOXI-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- PYRAMKIN-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- PYRIDOXKIN-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-14046
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-14181
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
