Difference between revisions of "COUMARYL-ALCOHOL"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00007237001_1 == * Synonym(s): == Reactions associated == * 2.7.8.15-RXN ** pantograph-galdieria.sulphuraria ** pantograph-a....") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] == |
+ | * smiles: | ||
+ | ** C(=CC1(=CC=C(O)C=C1))CO | ||
+ | * molecular weight: | ||
+ | ** 150.177 | ||
+ | * inchi key: | ||
+ | ** InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N | ||
+ | * common name: | ||
+ | ** 4-coumaryl alcohol | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** p-coumaryl alcohol | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-1102]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28386 28386] |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280535 5280535] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C02646 C02646] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4444166.html 4444166] | ||
+ | * HMDB : HMDB03654 | ||
+ | {{#set: smiles=C(=CC1(=CC=C(O)C=C1))CO}} | ||
+ | {{#set: molecular weight=150.177 }} | ||
+ | {{#set: inchi key=InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N}} | ||
+ | {{#set: common name=4-coumaryl alcohol}} | ||
+ | {{#set: common name=p-coumaryl alcohol}} | ||
+ | {{#set: produced by=RXN-1102}} |
Latest revision as of 15:10, 9 January 2019
Contents
Metabolite COUMARYL-ALCOHOL
- smiles:
- C(=CC1(=CC=C(O)C=C1))CO
- molecular weight:
- 150.177
- inchi key:
- InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N
- common name:
- 4-coumaryl alcohol
- Synonym(s):
- p-coumaryl alcohol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links