Difference between revisions of "PWY-7436"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17375 CPD-17375] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)CO)=...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17375 CPD-17375] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7436 PWY-7436] ==
* smiles:
+
** C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)CO)=O
+
* inchi key:
+
** InChIKey=RCALBBVHQNUWNO-OSFDYRCISA-N
+
 
* common name:
 
* common name:
** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol
+
** vitamin E biosynthesis (tocotrienols)
* molecular weight:
+
* taxonomic range:
** 650.978   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-3398]
 
* Synonym(s):
 
* Synonym(s):
 +
** tocotrienol biosynthesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''6''' reactions in the full pathway
* [[RXN-16121]]
+
* [[RXN-14917]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[CHC_T00009101001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[RXN-14918]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00000837001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[RXN-14919]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00000837001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14921 RXN-14921]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14922 RXN-14922]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14929 RXN-14929]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=vitamin E biosynthesis (tocotrienols)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820474 91820474]
+
{{#set: taxonomic range=TAX-3398}}
{{#set: smiles=C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)CO)=O}}
+
{{#set: common name=tocotrienol biosynthesis}}
{{#set: inchi key=InChIKey=RCALBBVHQNUWNO-OSFDYRCISA-N}}
+
{{#set: reaction found=3}}
{{#set: common name=1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol}}
+
{{#set: total reaction=6}}
{{#set: molecular weight=650.978    }}
+
{{#set: completion rate=50.0}}
{{#set: produced by=RXN-16121}}
+

Latest revision as of 15:16, 9 January 2019

Pathway PWY-7436

  • common name:
    • vitamin E biosynthesis (tocotrienols)
  • taxonomic range:
  • Synonym(s):
    • tocotrienol biosynthesis

Reaction(s) found

3 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links