Difference between revisions of "DEPHOSPHO-COA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-674 CPD-674] == * smiles: ** C(=O)([O-])C=CC1(=CC=CC=C1) * inchi key: ** InChIKey=WBYWAXJHA...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEPHOSPHO-COA DEPHOSPHO-COA] == |
* smiles: | * smiles: | ||
| − | ** C(=O)([O-])C= | + | ** CC(C)(COP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23))))C(O)C(=O)NCCC(=O)NCCS |
| + | * molecular weight: | ||
| + | ** 685.538 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=KDTSHFARGAKYJN-IBOSZNHHSA-L |
* common name: | * common name: | ||
| − | ** | + | ** 3'-dephospho-CoA |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | + | ** 3-dephospho-CoA | |
| − | ** 3- | + | ** dephosphocoenzyme A |
| − | ** | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DEPHOSPHOCOAKIN-RXN]] |
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PANTEPADENYLYLTRAN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | * METABOLIGHTS : MTBLC57328 | |
| − | * METABOLIGHTS : | + | * BIGG : dpcoa |
| − | * | + | * CAS : 3633-59-8 |
| − | * | + | * HMDB : HMDB01373 |
| − | + | ||
| − | + | ||
| − | + | ||
| − | * | + | |
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57328 57328] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles=C(=O)([O-])C= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00882 C00882] |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266562 45266562] |
| − | {{#set: | + | {{#set: smiles=CC(C)(COP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23))))C(O)C(=O)NCCC(=O)NCCS}} |
| − | {{#set: common name= | + | {{#set: molecular weight=685.538 }} |
| − | {{#set: consumed by= | + | {{#set: inchi key=InChIKey=KDTSHFARGAKYJN-IBOSZNHHSA-L}} |
| − | {{#set: produced by= | + | {{#set: common name=3'-dephospho-CoA}} |
| + | {{#set: common name=3-dephospho-CoA|dephosphocoenzyme A}} | ||
| + | {{#set: consumed by=DEPHOSPHOCOAKIN-RXN}} | ||
| + | {{#set: produced by=PANTEPADENYLYLTRAN-RXN}} | ||
Latest revision as of 15:17, 9 January 2019
Contents
Metabolite DEPHOSPHO-COA
- smiles:
- CC(C)(COP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23))))C(O)C(=O)NCCC(=O)NCCS
- molecular weight:
- 685.538
- inchi key:
- InChIKey=KDTSHFARGAKYJN-IBOSZNHHSA-L
- common name:
- 3'-dephospho-CoA
- Synonym(s):
- 3-dephospho-CoA
- dephosphocoenzyme A
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- METABOLIGHTS : MTBLC57328
- BIGG : dpcoa
- CAS : 3633-59-8
- HMDB : HMDB01373
- CHEBI:
- LIGAND-CPD:
- PUBCHEM:
"CC(C)(COP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23))))C(O)C(=O)NCCC(=O)NCCS" cannot be used as a page name in this wiki.
