Difference between revisions of "RXN-16042"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == * smiles: ** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1) * inc...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16042 RXN-16042] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16042 RXN-16042] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.23 EC-2.3.1.23] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | == | + | ** 1 [[Glycerolipids]][c] '''+''' 1 [[CPD-14394]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[CPD-17281]][c] |
| − | * [[ | + | * With common name(s): |
| − | * [[ | + | ** 1 a glycerolipid[c] '''+''' 1 (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl-CoA[c] '''=>''' 1 coenzyme A[c] '''+''' 1 a [glycerolipid]-icosatetraenoate[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[CHC_T00007447001_1]] | ||
| + | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWY-6958]], icosapentaenoate biosynthesis I (lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6958 PWY-6958] | ||
| + | ** '''2''' reactions found over '''8''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-2.3.1.23}} | |
| − | + | {{#set: gene associated=CHC_T00007447001_1}} | |
| − | + | {{#set: in pathway=PWY-6958}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-ectocarpus_siliculosus}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 14:58, 23 May 2018
Contents
Reaction RXN-16042
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Glycerolipids[c] + 1 CPD-14394[c] => 1 CO-A[c] + 1 CPD-17281[c]
- With common name(s):
- 1 a glycerolipid[c] + 1 (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl-CoA[c] => 1 coenzyme A[c] + 1 a [glycerolipid]-icosatetraenoate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00007447001_1
- Source: orthology-ectocarpus_siliculosus
Pathways
- PWY-6958, icosapentaenoate biosynthesis I (lower eukaryotes): PWY-6958
- 2 reactions found over 8 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
