Difference between revisions of "RXN-1404"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOATE BENZOATE] == * smiles: ** C(C1(C=CC=CC=1))([O-])=O * common name: ** benzoate * inchi...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOATE BENZOATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1404 RXN-1404] ==
* smiles:
+
* direction:
** C(C1(C=CC=CC=1))([O-])=O
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
** benzoate
+
** nitrilase
* inchi key:
+
* ec number:
** InChIKey=WPYMKLBDIGXBTP-UHFFFAOYSA-M
+
** [http://enzyme.expasy.org/EC/3.5.5.1 EC-3.5.5.1]
* molecular weight:
+
** 121.115   
+
 
* Synonym(s):
 
* Synonym(s):
** benzoic acid
 
** benzenecarboxylic acid
 
** phenylformic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-9336]]
+
** 1 [[INDOLEYL-CPD]][c] '''+''' 2 [[WATER]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[INDOLE_ACETATE_AUXIN]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
* [[BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN]]
+
** 1 indole-3-acetonitrile[c] '''+''' 2 H2O[c] '''=>''' 1 ammonium[c] '''+''' 1 indole-3-acetate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008379001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[CHC_T00008379001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways  ==
 +
* [[PWYQT-4476]], indole glucosinolate activation (herbivore attack): [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4476 PWYQT-4476]
 +
** '''1''' reactions found over '''13''' reactions in the full pathway
 +
* [[PWY-5026]], indole-3-acetate biosynthesis V (bacteria and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5026 PWY-5026]
 +
** '''1''' reactions found over '''1''' reactions in the full pathway
 +
* [[PWY-581]], indole-3-acetate biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-581 PWY-581]
 +
** '''2''' reactions found over '''13''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-original_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 65-85-0
+
* LIGAND-RXN:
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R03093 R03093]
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=242 242]
+
{{#set: direction=LEFT-TO-RIGHT}}
* HMDB : HMDB01870
+
{{#set: common name=nitrilase}}
* LIGAND-CPD:
+
{{#set: ec number=EC-3.5.5.1}}
** [http://www.genome.jp/dbget-bin/www_bget?C00180 C00180]
+
{{#set: gene associated=CHC_T00008379001|CHC_T00008379001_1}}
* CHEMSPIDER:
+
{{#set: in pathway=PWYQT-4476|PWY-5026|PWY-581}}
** [http://www.chemspider.com/Chemical-Structure.237.html 237]
+
{{#set: reconstruction category=orthology|annotation}}
* CHEBI:
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria|annotation-original_genome|orthology-ectocarpus_siliculosus}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16150 16150]
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
* METABOLIGHTS : MTBLC16150
+
{{#set: smiles=C(C1(C=CC=CC=1))([O-])=O}}
+
{{#set: common name=benzoate}}
+
{{#set: inchi key=InChIKey=WPYMKLBDIGXBTP-UHFFFAOYSA-M}}
+
{{#set: molecular weight=121.115    }}
+
{{#set: common name=benzoic acid|benzenecarboxylic acid|phenylformic acid}}
+
{{#set: produced by=RXN-9336}}
+
{{#set: consumed or produced by=BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN}}
+

Latest revision as of 15:26, 9 January 2019

Reaction RXN-1404

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • nitrilase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYQT-4476, indole glucosinolate activation (herbivore attack): PWYQT-4476
    • 1 reactions found over 13 reactions in the full pathway
  • PWY-5026, indole-3-acetate biosynthesis V (bacteria and fungi): PWY-5026
    • 1 reactions found over 1 reactions in the full pathway
  • PWY-581, indole-3-acetate biosynthesis II: PWY-581
    • 2 reactions found over 13 reactions in the full pathway

Reconstruction information

External links