Difference between revisions of "P224-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8848 CPD-8848] == * smiles: ** C=CC(CCC=C(CCC=C(CCC=C(C)C)C)C)(C)O * common name: ** (E,E)-...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P224-PWY P224-PWY] == |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** ( | + | ** sulfate reduction V (dissimilatory, to thiosulfate) |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** bisulfite reduction |
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''2''' reactions found over '''5''' reactions in the full pathway |
| − | + | * [[ADENYLYLSULFATE-REDUCTASE-RXN]] | |
| − | * [[RXN- | + | ** 0 associated gene: |
| − | == Reaction(s) | + | ** 1 reconstruction source(s) associated: |
| + | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
| + | * [[SULFATE-ADENYLYLTRANS-RXN]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[CHC_T00008316001_1]] | ||
| + | *** [[CHC_T00008927001_1]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=HYDROGENSULFITE-REDUCTASE-RXN HYDROGENSULFITE-REDUCTASE-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=R186-RXN R186-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17805 RXN-17805] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=sulfate reduction V (dissimilatory, to thiosulfate)}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=bisulfite reduction}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=5}} | |
| − | + | {{#set: completion rate=40.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name=( | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 15:20, 9 January 2019
Pathway P224-PWY
- common name:
- sulfate reduction V (dissimilatory, to thiosulfate)
- taxonomic range:
- Synonym(s):
- bisulfite reduction
Reaction(s) found
2 reactions found over 5 reactions in the full pathway
- ADENYLYLSULFATE-REDUCTASE-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- SULFATE-ADENYLYLTRANS-RXN
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
